EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C11H12O2 |
| Net Charge | 0 |
| Average Mass | 176.215 |
| Monoisotopic Mass | 176.08373 |
| SMILES | CC(=O)OC/C=C/c1ccccc1 |
| InChI | InChI=1S/C11H12O2/c1-10(12)13-9-5-8-11-6-3-2-4-7-11/h2-8H,9H2,1H3/b8-5+ |
| InChIKey | WJSDHUCWMSHDCR-VMPITWQZSA-N |
| Roles Classification |
|---|
| Biological Role: | plant metabolite Any eukaryotic metabolite produced during a metabolic reaction in plants, the kingdom that include flowering plants, conifers and other gymnosperms. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| trans-cinnamyl acetate (CHEBI:156069) has role plant metabolite (CHEBI:76924) |
| trans-cinnamyl acetate (CHEBI:156069) is a acetate ester (CHEBI:47622) |
| UniProt Name | Source |
|---|---|
| (E)-cinnamyl acetate | UniProt |
| Citations |
|---|