EMBL-EBI | Chemical Biology Resources | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C19H25NO3 |
| Net Charge | 0 |
| Average Mass | 315.413 |
| Monoisotopic Mass | 315.18344 |
| SMILES | CCC1=CC(=O)[C@]2(C)C1=CC=C(C)C[C@@H]2OC(=O)[C@@H]1CCCN1 |
| InChI | InChI=1S/C19H25NO3/c1-4-13-11-16(21)19(3)14(13)8-7-12(2)10-17(19)23-18(22)15-6-5-9-20-15/h7-8,11,15,17,20H,4-6,9-10H2,1-3H3/t15-,17-,19-/m0/s1 |
| InChIKey | LOOAMPJDSIVZQC-IEZWGBDMSA-N |
| Species of Metabolite | Component | Source | Comments |
|---|---|---|---|
| Aspergillus aculeatus (ncbitaxon:5053) | cell suspension culture (BTO:0000221) | PubMed (25068785) |
| Roles Classification |
|---|
| Biological Role: | Aspergillus metabolite Any fungal metabolite produced during a metabolic reaction in the mould, Aspergillus . |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| aculene A (CHEBI:156057) has functional parent aculene C (CHEBI:155912) |
| aculene A (CHEBI:156057) has role Aspergillus metabolite (CHEBI:76956) |
| aculene A (CHEBI:156057) is a L-proline derivative (CHEBI:84186) |
| aculene A (CHEBI:156057) is a carbobicyclic compound (CHEBI:36785) |
| aculene A (CHEBI:156057) is a carboxylic ester (CHEBI:33308) |
| aculene A (CHEBI:156057) is a sesquiterpenoid (CHEBI:26658) |
| aculene A (CHEBI:156057) is conjugate base of aculene A(1+) (CHEBI:155914) |
| Incoming Relation(s) |
| aculene A(1+) (CHEBI:155914) is conjugate acid of aculene A (CHEBI:156057) |
| IUPAC Name |
|---|
| (3aR,4S)-1-ethyl-3a,6-dimethyl-3-oxo-3,3a,4,5-tetrahydroazulen-4-yl L-prolinate |
| Synonym | Source |
|---|---|
| (3aR,4S)-1-ethyl-3a,6-dimethyl-3-oxo-3,3a,4,5-tetrahydroazulen-4-yl (2S)-pyrrolidine-2-carboxylate | IUPAC |
| Citations |
|---|