EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C6H8N2O2 |
| Net Charge | 0 |
| Average Mass | 140.142 |
| Monoisotopic Mass | 140.05858 |
| SMILES | O=C(O)CCn1ccnc1 |
| InChI | InChI=1S/C6H8N2O2/c9-6(10)1-3-8-4-2-7-5-8/h2,4-5H,1,3H2,(H,9,10) |
| InChIKey | VSFNAZLYGOOSEY-UHFFFAOYSA-N |
| Species of Metabolite | Component | Source | Comments |
|---|---|---|---|
| Homo sapiens (ncbitaxon:9606) | |||
| faeces (UBERON:0001988) | PubMed (6136484) | ||
| urine (BTO:0001419) | PubMed (5038749) |
| Roles Classification |
|---|
| Chemical Role: | Bronsted acid A molecular entity capable of donating a hydron to an acceptor (Brønsted base). |
| Biological Role: | human urinary metabolite Any metabolite (endogenous or exogenous) found in human urine samples. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| 3-(1H-imidazol-1-yl)propanoic acid (CHEBI:156055) has functional parent propionic acid (CHEBI:30768) |
| 3-(1H-imidazol-1-yl)propanoic acid (CHEBI:156055) has role human urinary metabolite (CHEBI:84087) |
| 3-(1H-imidazol-1-yl)propanoic acid (CHEBI:156055) is a imidazolyl carboxylic acid (CHEBI:38307) |
| IUPAC Name |
|---|
| 3-(1H-imidazol-1-yl)propanoic acid |
| Synonyms | Source |
|---|---|
| imidazolepropionic acid | ChEBI |
| 3-imidazol-1-yl-propionic acid | ChEBI |
| Registry Numbers | Sources |
|---|---|
| CAS:18999-45-6 | ChEBI |
| Citations |
|---|