EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C25H29N3O2 |
| Net Charge | 0 |
| Average Mass | 403.526 |
| Monoisotopic Mass | 403.22598 |
| SMILES | COc1cc(CNC(=O)C2CCN(C(C)c3cccc4ccccc34)CC2)ccn1 |
| InChI | InChI=1S/C25H29N3O2/c1-18(22-9-5-7-20-6-3-4-8-23(20)22)28-14-11-21(12-15-28)25(29)27-17-19-10-13-26-24(16-19)30-2/h3-10,13,16,18,21H,11-12,14-15,17H2,1-2H3,(H,27,29) |
| InChIKey | MMIABLSMKGWQKD-UHFFFAOYSA-N |
| Roles Classification |
|---|
| Chemical Role: | Bronsted base A molecular entity capable of accepting a hydron from a donor (Brønsted acid). |
| Biological Roles: | protease inhibitor A compound which inhibits or antagonizes the biosynthesis or actions of proteases (endopeptidases). anticoronaviral agent Any antiviral agent which inhibits the activity of coronaviruses. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| rac5c (CHEBI:156041) has role anticoronaviral agent (CHEBI:149553) |
| rac5c (CHEBI:156041) has role protease inhibitor (CHEBI:37670) |
| rac5c (CHEBI:156041) is a aromatic ether (CHEBI:35618) |
| rac5c (CHEBI:156041) is a naphthalenes (CHEBI:25477) |
| rac5c (CHEBI:156041) is a piperidinecarboxamide (CHEBI:48592) |
| rac5c (CHEBI:156041) is a pyridines (CHEBI:26421) |
| rac5c (CHEBI:156041) is a secondary carboxamide (CHEBI:140325) |
| rac5c (CHEBI:156041) is a tertiary amino compound (CHEBI:50996) |
| IUPAC Name |
|---|
| N-[(2-methoxypyridin-4-yl)methyl]-1-[1-(naphthalen-1-yl)ethyl]piperidine-4-carboxamide |
| Citations |
|---|