EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C14H20O2 |
| Net Charge | 0 |
| Average Mass | 220.312 |
| Monoisotopic Mass | 220.14633 |
| SMILES | [H][C@]12CC=C(C)C[C@H](O)[C@]1(C)C(=O)C=C2CC |
| InChI | InChI=1S/C14H20O2/c1-4-10-8-13(16)14(3)11(10)6-5-9(2)7-12(14)15/h5,8,11-12,15H,4,6-7H2,1-3H3/t11-,12+,14-/m1/s1 |
| InChIKey | IIQOUDJDCRTCJY-MBNYWOFBSA-N |
| Species of Metabolite | Component | Source | Comments |
|---|---|---|---|
| Aspergillus aculeatus (ncbitaxon:5053) | cell suspension culture (BTO:0000221) | PubMed (25068785) | |
| Penicillium sp. SCS-KFD08 (ncbitaxon:1808020) | cell suspension culture (BTO:0000221) | PubMed (27709333) |
| Roles Classification |
|---|
| Biological Roles: | Aspergillus metabolite Any fungal metabolite produced during a metabolic reaction in the mould, Aspergillus . Penicillium metabolite Any fungal metabolite produced during a metabolic reaction in Penicillium. marine metabolite Any metabolite produced during a metabolic reaction in marine macro- and microorganisms. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| aculene D (CHEBI:155910) has role Aspergillus metabolite (CHEBI:76956) |
| aculene D (CHEBI:155910) has role Penicillium metabolite (CHEBI:76964) |
| aculene D (CHEBI:155910) has role marine metabolite (CHEBI:76507) |
| aculene D (CHEBI:155910) is a carbobicyclic compound (CHEBI:36785) |
| aculene D (CHEBI:155910) is a secondary alcohol (CHEBI:35681) |
| aculene D (CHEBI:155910) is a sesquiterpenoid (CHEBI:26658) |
| Incoming Relation(s) |
| aculene B (CHEBI:156056) has functional parent aculene D (CHEBI:155910) |
| IUPAC Name |
|---|
| (3aR,8S,8aR)-3-ethyl-8-hydroxy-6,8a-dimethyl-4,7,8,8a-tetrahydroazulen-1(3aH)-one |
| UniProt Name | Source |
|---|---|
| aculene D | UniProt |
| Citations |
|---|