EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C28H46O |
| Net Charge | 0 |
| Average Mass | 398.675 |
| Monoisotopic Mass | 398.35487 |
| SMILES | [H][C@@]12CC=C3C[C@@H](O)CC[C@]3(C)[C@@]1([H])CC[C@@]1(C)[C@@]2([H])CC[C@]1([H])[C@H](C)/C=C/[C@@H](C)C(C)C |
| InChI | InChI=1S/C28H46O/c1-18(2)19(3)7-8-20(4)24-11-12-25-23-10-9-21-17-22(29)13-15-27(21,5)26(23)14-16-28(24,25)6/h7-9,18-20,22-26,29H,10-17H2,1-6H3/b8-7+/t19-,20-,22+,23+,24-,25+,26+,27+,28-/m1/s1 |
| InChIKey | OILXMJHPFNGGTO-SDMVIZLASA-N |
| Wikipedia |
|---|
| Species of Metabolite | Component | Source | Comments |
|---|---|---|---|
| Aureoumbra lagunensis (ncbitaxon:44058) | - | PubMed (11397449) | |
| Brassica campestris (ncbitaxon:145471) | seed (BTO:0001226) | PubMed (25276975) | |
| Brassica juncea (ncbitaxon:3707) | seed (BTO:0001226) | DOI (10.1016/S0031-9422(00)86991-5) | |
| Comatula (ncbitaxon:1320698) | - | PubMed (6030051) | |
| Cosmoglyphus hughesi (ncbitaxon:223505) | - | PubMed (17456445) | |
| Cryptomonas sp. (ncbitaxon:3031) | - | DOI (10.1016/0031-9422(83)83028-3) | |
| Isochrysis galbana (ncbitaxon:37099) | - | DOI (10.1016/0031-9422(83)83028-3) | |
| Mytilidae (ncbitaxon:6547) | - | PubMed (25429428) | |
| Phaeocystis pouchetii (ncbitaxon:33659) | Whole Organism (NCIT:C13413) | MetaboLights (MTBLS758) | Strain: Phaeocystis pouchetii str. AJ01 |
| Roles Classification |
|---|
| Biological Roles: | marine metabolite Any metabolite produced during a metabolic reaction in marine macro- and microorganisms. algal metabolite Any eukaryotic metabolite produced during a metabolic reaction in algae including unicellular organisms like chlorella and diatoms to multicellular organisms like giant kelps and brown algae. plant metabolite Any eukaryotic metabolite produced during a metabolic reaction in plants, the kingdom that include flowering plants, conifers and other gymnosperms. animal metabolite Any eukaryotic metabolite produced during a metabolic reaction in animals that include diverse creatures from sponges, insects to mammals. |
| Application: | biomarker A substance used as an indicator of a biological state. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| crinosterol (CHEBI:155905) has functional parent campesterol (CHEBI:28623) |
| crinosterol (CHEBI:155905) has role algal metabolite (CHEBI:84735) |
| crinosterol (CHEBI:155905) has role animal metabolite (CHEBI:75767) |
| crinosterol (CHEBI:155905) has role biomarker (CHEBI:59163) |
| crinosterol (CHEBI:155905) has role marine metabolite (CHEBI:76507) |
| crinosterol (CHEBI:155905) has role plant metabolite (CHEBI:76924) |
| crinosterol (CHEBI:155905) is a 3β-hydroxy-Δ5-steroid (CHEBI:1722) |
| crinosterol (CHEBI:155905) is a 3β-sterol (CHEBI:35348) |
| crinosterol (CHEBI:155905) is a ergostanoid (CHEBI:50403) |
| crinosterol (CHEBI:155905) is a phytosterols (CHEBI:26125) |
| IUPAC Name |
|---|
| (22E,24S)-ergosta-5,22-dien-3β-ol |
| Synonyms | Source |
|---|---|
| 22-dehydrocampesterol | ChEBI |
| 24-epibrassicasterol | LIPID MAPS |
| (24S)-24-methyl-cholesta-5,22(E)-dien-3β-ol | ChEBI |
| campesta-5,22E-dien-3β-ol | LIPID MAPS |
| (E)-22-dehydrocampesterol | ChEBI |
| trans-22-dehydrocampesterol | ChEBI |
| Manual Xrefs | Databases |
|---|---|
| CPD-8135 | MetaCyc |
| Epibrassicasterol | Wikipedia |
| FDB030745 | FooDB |
| LMST01030114 | LIPID MAPS |
| Citations |
|---|