EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
CHEBI:155904 - (+)-albicanol
| Formula | C15H26O |
| Net Charge | 0 |
| Average Mass | 222.372 |
| Monoisotopic Mass | 222.19837 |
| SMILES | [H][C@@]12CCC(=C)[C@H](CO)[C@@]1(C)CCCC2(C)C |
| InChI | InChI=1S/C15H26O/c1-11-6-7-13-14(2,3)8-5-9-15(13,4)12(11)10-16/h12-13,16H,1,5-10H2,2-4H3/t12-,13-,15+/m0/s1 |
| InChIKey | ZPTSRWNMMWXEHX-KCQAQPDRSA-N |
| Species of Metabolite | Component | Source | Comments |
|---|---|---|---|
| Bazzania (ncbitaxon:13807) | - | DOI (10.1016/S0031-9422(00)82666-7) | |
| Diplophyllum albicans (ncbitaxon:264775) | - | Article (Ohta (1977), Tetrahedron, 33, 617.) | |
| Dryopteris fragrans (ncbitaxon:239565) | whole plant (BTO:0001461) | PubMed (24647035) | |
| Frullania monocera (ncbitaxon:236963) | - | DOI (10.1016/S0031-9422(02)00542-3) | |
| Loxodonta (ncbitaxon:9784) | gland (BTO:0000522) | PubMed (12350155) | Found in the temporal gland secretions of African elephants. |
| Perenniporia tephropora (ncbitaxon:483159) | cell suspension culture (BTO:0000221) | PubMed (22660771) | Strain: Z41 |
| Roles Classification |
|---|
| Biological Roles: | fungal metabolite Any eukaryotic metabolite produced during a metabolic reaction in fungi, the kingdom that includes microorganisms such as the yeasts and moulds. antifungal agent An antimicrobial agent that destroys fungi by suppressing their ability to grow or reproduce. marine metabolite Any metabolite produced during a metabolic reaction in marine macro- and microorganisms. plant metabolite Any eukaryotic metabolite produced during a metabolic reaction in plants, the kingdom that include flowering plants, conifers and other gymnosperms. mammalian metabolite Any animal metabolite produced during a metabolic reaction in mammals. |
| Applications: | antifeedant A substance that prevents pests from feeding. antineoplastic agent A substance that inhibits or prevents the proliferation of neoplasms. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| (+)-albicanol (CHEBI:155904) has parent hydride drimane (CHEBI:36474) |
| (+)-albicanol (CHEBI:155904) has role antifeedant (CHEBI:22583) |
| (+)-albicanol (CHEBI:155904) has role antifungal agent (CHEBI:35718) |
| (+)-albicanol (CHEBI:155904) has role antineoplastic agent (CHEBI:35610) |
| (+)-albicanol (CHEBI:155904) has role fungal metabolite (CHEBI:76946) |
| (+)-albicanol (CHEBI:155904) has role mammalian metabolite (CHEBI:75768) |
| (+)-albicanol (CHEBI:155904) has role marine metabolite (CHEBI:76507) |
| (+)-albicanol (CHEBI:155904) has role plant metabolite (CHEBI:76924) |
| (+)-albicanol (CHEBI:155904) is a carbobicyclic compound (CHEBI:36785) |
| (+)-albicanol (CHEBI:155904) is a homoallylic alcohol (CHEBI:134362) |
| (+)-albicanol (CHEBI:155904) is a primary alcohol (CHEBI:15734) |
| (+)-albicanol (CHEBI:155904) is a sesquiterpenoid (CHEBI:26658) |
| IUPAC Name |
|---|
| [(1S,4aS,8aS)-5,5,8a-trimethyl-2-methylidenedecahydronaphthalen-1-yl]methanol |
| Synonyms | Source |
|---|---|
| (1S,4aα)-decahydro-5,5,8aβ-trimethyl-2-methylenenaphthalene-1-methanol | SUBMITTER |
| (4aα)-2-methylene-5,5,8aβ-trimethyldecalin-1β-methanol | SUBMITTER |
| (4aα)-decahydro-5,5,8aβ-trimethyl-2-methylenenaphthalene-1β-methanol | SUBMITTER |
| (8aS)-albicanol | ChEBI |
| albicanol | ChemIDplus |
| Manual Xrefs | Databases |
|---|---|
| C00020283 | KNApSAcK |
| Registry Numbers | Sources |
|---|---|
| CAS:54632-04-1 | ChemIDplus |
| Citations |
|---|