EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C15H26O |
| Net Charge | 0 |
| Average Mass | 222.372 |
| Monoisotopic Mass | 222.19837 |
| SMILES | [H][C@@]12CCC(=C)[C@H](CO)[C@@]1(C)CCCC2(C)C |
| InChI | InChI=1S/C15H26O/c1-11-6-7-13-14(2,3)8-5-9-15(13,4)12(11)10-16/h12-13,16H,1,5-10H2,2-4H3/t12-,13-,15+/m0/s1 |
| InChIKey | ZPTSRWNMMWXEHX-KCQAQPDRSA-N |
| Species of Metabolite | Component | Source | Comments |
|---|---|---|---|
| Bazzania (ncbitaxon:13807) | - | DOI (10.1016/S0031-9422(00)82666-7) | |
| Diplophyllum albicans (ncbitaxon:264775) | - | Article (Ohta (1977), Tetrahedron, 33, 617.) | |
| Dryopteris fragrans (ncbitaxon:239565) | whole plant (BTO:0001461) | PubMed (24647035) | |
| Frullania monocera (ncbitaxon:236963) | - | DOI (10.1016/S0031-9422(02)00542-3) | |
| Loxodonta (ncbitaxon:9784) | gland (BTO:0000522) | PubMed (12350155) | Found in the temporal gland secretions of African elephants. |
| Perenniporia tephropora (ncbitaxon:483159) | cell suspension culture (BTO:0000221) | PubMed (22660771) | Strain: Z41 |
| Roles Classification |
|---|
| Biological Roles: | antifungal agent An antimicrobial agent that destroys fungi by suppressing their ability to grow or reproduce. plant metabolite Any eukaryotic metabolite produced during a metabolic reaction in plants, the kingdom that include flowering plants, conifers and other gymnosperms. fungal metabolite Any eukaryotic metabolite produced during a metabolic reaction in fungi, the kingdom that includes microorganisms such as the yeasts and moulds. marine metabolite Any metabolite produced during a metabolic reaction in marine macro- and microorganisms. mammalian metabolite Any animal metabolite produced during a metabolic reaction in mammals. |
| Applications: | antifeedant A substance that prevents pests from feeding. antineoplastic agent A substance that inhibits or prevents the proliferation of neoplasms. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| (+)-albicanol (CHEBI:155904) has parent hydride drimane (CHEBI:36474) |
| (+)-albicanol (CHEBI:155904) has role antifeedant (CHEBI:22583) |
| (+)-albicanol (CHEBI:155904) has role antifungal agent (CHEBI:35718) |
| (+)-albicanol (CHEBI:155904) has role antineoplastic agent (CHEBI:35610) |
| (+)-albicanol (CHEBI:155904) has role fungal metabolite (CHEBI:76946) |
| (+)-albicanol (CHEBI:155904) has role mammalian metabolite (CHEBI:75768) |
| (+)-albicanol (CHEBI:155904) has role marine metabolite (CHEBI:76507) |
| (+)-albicanol (CHEBI:155904) has role plant metabolite (CHEBI:76924) |
| (+)-albicanol (CHEBI:155904) is a carbobicyclic compound (CHEBI:36785) |
| (+)-albicanol (CHEBI:155904) is a homoallylic alcohol (CHEBI:134362) |
| (+)-albicanol (CHEBI:155904) is a primary alcohol (CHEBI:15734) |
| (+)-albicanol (CHEBI:155904) is a sesquiterpenoid (CHEBI:26658) |
| IUPAC Name |
|---|
| [(1S,4aS,8aS)-5,5,8a-trimethyl-2-methylidenedecahydronaphthalen-1-yl]methanol |
| Synonyms | Source |
|---|---|
| (1S,4aα)-decahydro-5,5,8aβ-trimethyl-2-methylenenaphthalene-1-methanol | SUBMITTER |
| (4aα)-2-methylene-5,5,8aβ-trimethyldecalin-1β-methanol | SUBMITTER |
| (4aα)-decahydro-5,5,8aβ-trimethyl-2-methylenenaphthalene-1β-methanol | SUBMITTER |
| (8aS)-albicanol | ChEBI |
| albicanol | ChemIDplus |
| Manual Xrefs | Databases |
|---|---|
| C00020283 | KNApSAcK |
| Registry Numbers | Sources |
|---|---|
| CAS:54632-04-1 | ChemIDplus |
| Citations |
|---|