EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C20H22O8 |
| Net Charge | 0 |
| Average Mass | 390.388 |
| Monoisotopic Mass | 390.13147 |
| SMILES | O=C(O[C@H]1[C@H](Oc2ccccc2CO)O[C@H](CO)[C@@H](O)[C@@H]1O)c1ccccc1 |
| InChI | InChI=1S/C20H22O8/c21-10-13-8-4-5-9-14(13)26-20-18(17(24)16(23)15(11-22)27-20)28-19(25)12-6-2-1-3-7-12/h1-9,15-18,20-24H,10-11H2/t15-,16-,17+,18-,20-/m1/s1 |
| InChIKey | FWPNCAYVELBDRB-BFMVXSJESA-N |
| Species of Metabolite | Component | Source | Comments |
|---|---|---|---|
| Homalium cochinchinense (ncbitaxon:1009479) | bark (BTO:0001301) | PubMed (15104498) | Isolated from root bark. |
| Populus alba (ncbitaxon:43335) | - | PubMed (31137712) | |
| Populus tomentosa (ncbitaxon:118781) | bark (BTO:0001301) | PubMed (22860454) | Isolated from stem bark. |
| Salix acutifolia (ncbitaxon:1233969) | stem (BTO:0001300) | PubMed (26820172) | |
| Salix tetrasperma (ncbitaxon:75722) | leaf (BTO:0000713) | PubMed (23016273) |
| Roles Classification |
|---|
| Biological Role: | plant metabolite Any eukaryotic metabolite produced during a metabolic reaction in plants, the kingdom that include flowering plants, conifers and other gymnosperms. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| tremuloidin (CHEBI:155892) has functional parent salicin (CHEBI:17814) |
| tremuloidin (CHEBI:155892) has role plant metabolite (CHEBI:76924) |
| tremuloidin (CHEBI:155892) is a aromatic primary alcohol (CHEBI:33857) |
| tremuloidin (CHEBI:155892) is a aryl β-D-glucoside (CHEBI:28749) |
| tremuloidin (CHEBI:155892) is a benzoate ester (CHEBI:36054) |
| tremuloidin (CHEBI:155892) is a benzyl alcohols (CHEBI:22743) |
| tremuloidin (CHEBI:155892) is a monosaccharide derivative (CHEBI:63367) |
| IUPAC Name |
|---|
| 2-(hydroxymethyl)phenyl 2-O-benzoyl-β-D-glucopyranoside |
| Synonyms | Source |
|---|---|
| 2'-benzoylsalicin | ChEBI |
| 2'-O-benzoylsalicin | ChEBI |
| Citations |
|---|