EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C6H12O6 |
| Net Charge | 0 |
| Average Mass | 180.156 |
| Monoisotopic Mass | 180.06339 |
| SMILES | OC[C@H]1OC(O)[C@@H](O)[C@H](O)[C@H]1O |
| WURCS | WURCS=2.0/1,1,0/[a1212h-1x_1-5]/1/ |
| InChI | InChI=1S/C6H12O6/c7-1-2-3(8)4(9)5(10)6(11)12-2/h2-11H,1H2/t2-,3+,4-,5+,6?/m1/s1 |
| InChIKey | WQZGKKKJIJFFOK-YIDFTEPTSA-N |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| D-idopyranose (CHEBI:155878) is a D-idose (CHEBI:28014) |
| D-idopyranose (CHEBI:155878) is enantiomer of L-idopyranose (CHEBI:86061) |
| Incoming Relation(s) |
| α-D-idopyranose (CHEBI:149174) is a D-idopyranose (CHEBI:155878) |
| β-D-idopyranose (CHEBI:155701) is a D-idopyranose (CHEBI:155878) |
| L-idopyranose (CHEBI:86061) is enantiomer of D-idopyranose (CHEBI:155878) |
| IUPAC Names |
|---|
| D-idopyranose |
| D-Idop |
| Manual Xrefs | Databases |
|---|---|
| G97146EI | GlyTouCan |