EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C8H8O3 |
| Net Charge | 0 |
| Average Mass | 152.149 |
| Monoisotopic Mass | 152.04734 |
| SMILES | [H]C(=O)c1c(C)cc(O)cc1O |
| InChI | InChI=1S/C8H8O3/c1-5-2-6(10)3-8(11)7(5)4-9/h2-4,10-11H,1H3 |
| InChIKey | LJFQTUKKYWDRAT-UHFFFAOYSA-N |
| Species of Metabolite | Component | Source | Comments |
|---|---|---|---|
| Grifola frondosa (ncbitaxon:5627) | cell suspension culture (BTO:0000221) | PubMed (17002422) | |
| Phlebiopsis gigantea (ncbitaxon:82310) | cell suspension culture (BTO:0000221) | PubMed (29895730) |
| Roles Classification |
|---|
| Biological Roles: | fungal metabolite Any eukaryotic metabolite produced during a metabolic reaction in fungi, the kingdom that includes microorganisms such as the yeasts and moulds. apoptosis inducer Any substance that induces the process of apoptosis (programmed cell death) in multi-celled organisms. |
| Application: | anti-inflammatory agent Any compound that has anti-inflammatory effects. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| 2,4-dihydroxy-6-methylbenzaldehyde (CHEBI:155863) has role anti-inflammatory agent (CHEBI:67079) |
| 2,4-dihydroxy-6-methylbenzaldehyde (CHEBI:155863) has role apoptosis inducer (CHEBI:68495) |
| 2,4-dihydroxy-6-methylbenzaldehyde (CHEBI:155863) has role fungal metabolite (CHEBI:76946) |
| 2,4-dihydroxy-6-methylbenzaldehyde (CHEBI:155863) is a dihydroxybenzaldehyde (CHEBI:50196) |
| IUPAC Name |
|---|
| 2,4-dihydroxy-6-methylbenzaldehyde |
| Synonyms | Source |
|---|---|
| 2-formyl-5-hydroxy-3-methylphenol | ChemIDplus |
| 2-methyl-4,6-dihydroxybenzaldehyde | ChEBI |
| 4-formyl-5-methylbenzene-1,3-diol | ChemIDplus |
| 4-formyl-5-methylresorcinol | ChemIDplus |
| 6-methyl-β-resorcyladehyde | ChemIDplus |
| o-orsellinaldehyde | ChemIDplus |
| UniProt Name | Source |
|---|---|
| orsellinaldehyde | UniProt |
| Registry Numbers | Sources |
|---|---|
| CAS:487-69-4 | ChemIDplus |
| Citations |
|---|