EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C12H10O5 |
| Net Charge | 0 |
| Average Mass | 234.207 |
| Monoisotopic Mass | 234.05282 |
| SMILES | CC(=O)Cc1cc2cc(O)cc(O)c2c(=O)o1 |
| InChI | InChI=1S/C12H10O5/c1-6(13)2-9-4-7-3-8(14)5-10(15)11(7)12(16)17-9/h3-5,14-15H,2H2,1H3 |
| InChIKey | ASXQQFFJWJUYLO-UHFFFAOYSA-N |
| Species of Metabolite | Component | Source | Comments |
|---|---|---|---|
| Aspergillus nidulans (ncbitaxon:162425) | - | PubMed (22510154) |
| Roles Classification |
|---|
| Biological Role: | Aspergillus metabolite Any fungal metabolite produced during a metabolic reaction in the mould, Aspergillus . |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| 6,8-dihydroxy-3-(2-oxopropyl)-isocoumarin (CHEBI:155858) has role Aspergillus metabolite (CHEBI:76956) |
| 6,8-dihydroxy-3-(2-oxopropyl)-isocoumarin (CHEBI:155858) is a hexaketide (CHEBI:59870) |
| 6,8-dihydroxy-3-(2-oxopropyl)-isocoumarin (CHEBI:155858) is a isocoumarins (CHEBI:38758) |
| 6,8-dihydroxy-3-(2-oxopropyl)-isocoumarin (CHEBI:155858) is a methyl ketone (CHEBI:51867) |
| 6,8-dihydroxy-3-(2-oxopropyl)-isocoumarin (CHEBI:155858) is a phenols (CHEBI:33853) |
| IUPAC Name |
|---|
| 6,8-dihydroxy-3-(2-oxopropyl)-1H-isochromen-1-one |
| Synonyms | Source |
|---|---|
| 6,8-dihydroxy-3-(2-oxopropyl)-1H-2-benzopyran-1-one | IUPAC |
| 3-(2-oxopropyl)-6,8-dihydroxyisocoumarin | ChEBI |
| 6,8-dihydroxy-3-(2-oxopropyl)isochromen-1-one | ChEBI |
| UniProt Name | Source |
|---|---|
| 6,8-dihydroxy-3-(2-oxopropyl)-isocoumarin | UniProt |
| Citations |
|---|