EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C9H10FNO2 |
| Net Charge | 0 |
| Average Mass | 183.182 |
| Monoisotopic Mass | 183.06956 |
| SMILES | N[C@@H](Cc1ccccc1F)C(=O)O |
| InChI | InChI=1S/C9H10FNO2/c10-7-4-2-1-3-6(7)5-8(11)9(12)13/h1-4,8H,5,11H2,(H,12,13)/t8-/m0/s1 |
| InChIKey | NYCRCTMDYITATC-QMMMGPOBSA-N |
| Roles Classification |
|---|
| Chemical Roles: | Bronsted base A molecular entity capable of accepting a hydron from a donor (Brønsted acid). Bronsted acid A molecular entity capable of donating a hydron to an acceptor (Brønsted base). |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| 2-fluoro-L-phenylalanine (CHEBI:155831) is a L-phenylalanine derivative (CHEBI:84144) |
| 2-fluoro-L-phenylalanine (CHEBI:155831) is a 2-fluorophenylalanine (CHEBI:155833) |
| 2-fluoro-L-phenylalanine (CHEBI:155831) is enantiomer of 2-fluoro-D-phenylalanine (CHEBI:155832) |
| Incoming Relation(s) |
| 2-fluoro-DL-phenylalanine (CHEBI:152048) has part 2-fluoro-L-phenylalanine (CHEBI:155831) |
| 2-fluoro-D-phenylalanine (CHEBI:155832) is enantiomer of 2-fluoro-L-phenylalanine (CHEBI:155831) |
| IUPAC Name |
|---|
| 2-fluoro-L-phenylalanine |
| Synonyms | Source |
|---|---|
| 2-fluoro-L-Phe | ChEBI |
| (2S)-2-amino-3-(2-fluorophenyl)propanoic acid | ChEBI |
| o-fluoro-L-phenylalanine | ChEBI |
| (S)-2-amino-3-(2-fluorophenyl)propanoic acid | ChEBI |
| (S)-3-(2-fluorophenyl)-2-aminopropanoic acid | ChEBI |
| L-2-fluorophenylalanine | ChEBI |
| Registry Numbers | Sources |
|---|---|
| Reaxys:2805791 | Reaxys |
| CAS:19883-78-4 | ChEBI |
| Citations |
|---|