EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
CHEBI:15583 - (R)-2-ethylmalic acid
| Formula | C6H10O5 |
| Net Charge | 0 |
| Average Mass | 162.141 |
| Monoisotopic Mass | 162.05282 |
| SMILES | CC[C@@](O)(CC(=O)O)C(=O)O |
| InChI | InChI=1S/C6H10O5/c1-2-6(11,5(9)10)3-4(7)8/h11H,2-3H2,1H3,(H,7,8)(H,9,10)/t6-/m1/s1 |
| InChIKey | YVYGHRNLPUMVBU-ZCFIWIBFSA-N |
| Roles Classification |
|---|
| Chemical Role: | Bronsted acid A molecular entity capable of donating a hydron to an acceptor (Brønsted base). |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| (R)-2-ethylmalic acid (CHEBI:15583) has functional parent succinic acid (CHEBI:15741) |
| (R)-2-ethylmalic acid (CHEBI:15583) is a 2-hydroxydicarboxylic acid (CHEBI:50263) |
| (R)-2-ethylmalic acid (CHEBI:15583) is a dicarboxylic fatty acid (CHEBI:189840) |
| (R)-2-ethylmalic acid (CHEBI:15583) is conjugate acid of (R)-2-ethylmalate(2−) (CHEBI:57423) |
| Incoming Relation(s) |
| (R)-2-ethylmalate(2−) (CHEBI:57423) is conjugate base of (R)-2-ethylmalic acid (CHEBI:15583) |
| IUPAC Name |
|---|
| (2R)-2-ethyl-2-hydroxybutanedioic acid |
| Synonyms | Source |
|---|---|
| (R)-2-ethylmalate | ChEBI |
| (R)-2-Ethylmalate | KEGG COMPOUND |