EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C31H21F6N3O4 |
| Net Charge | 0 |
| Average Mass | 613.514 |
| Monoisotopic Mass | 613.14363 |
| SMILES | Cc1cc(-c2ccc(OC(F)(F)F)cc2)ccc1COc1ccccc1-c1cccc(-n2ncc(C(=O)O)c2C(F)(F)F)n1 |
| InChI | InChI=1S/C31H21F6N3O4/c1-18-15-20(19-11-13-22(14-12-19)44-31(35,36)37)9-10-21(18)17-43-26-7-3-2-5-23(26)25-6-4-8-27(39-25)40-28(30(32,33)34)24(16-38-40)29(41)42/h2-16H,17H2,1H3,(H,41,42) |
| InChIKey | YNDMDCJWXXDPFE-UHFFFAOYSA-N |
| Roles Classification |
|---|
| Chemical Role: | Bronsted acid A molecular entity capable of donating a hydron to an acceptor (Brønsted base). |
| Biological Role: | soluble guanylate cyclase activator Any compound that binds to and activates soluble guanylate cyclase (EC 4.6.1.2). |
| Application: | antihypertensive agent Any drug used in the treatment of acute or chronic vascular hypertension regardless of pharmacological mechanism. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| GSK2181236A (CHEBI:155824) has role antihypertensive agent (CHEBI:35674) |
| GSK2181236A (CHEBI:155824) has role soluble guanylate cyclase activator (CHEBI:76022) |
| GSK2181236A (CHEBI:155824) is a aromatic ether (CHEBI:35618) |
| GSK2181236A (CHEBI:155824) is a biphenyls (CHEBI:22888) |
| GSK2181236A (CHEBI:155824) is a monocarboxylic acid (CHEBI:25384) |
| GSK2181236A (CHEBI:155824) is a organofluorine compound (CHEBI:37143) |
| GSK2181236A (CHEBI:155824) is a pyrazoles (CHEBI:26410) |
| GSK2181236A (CHEBI:155824) is a pyridines (CHEBI:26421) |
| IUPAC Name |
|---|
| 1-[6-(2-{[3-methyl-4'-(trifluoromethoxy)[biphenyl]-4-yl]methoxy}phenyl)pyridin-2-yl]-5-(trifluoromethyl)-1H-pyrazole-4-carboxylic acid |
| Synonyms | Source |
|---|---|
| GSK-2181236A | ChEBI |
| GSK 2181236A | ChEBI |
| 1-(6-{2-[({3-methyl-4'-[(trifluoromethyl)oxy]-4-biphenylyl}methyl)oxy]phenyl}-2-pyridinyl)-5-(trifluoromethyl)-1H-pyrazole-4-carboxylic acid | ChEBI |
| Registry Numbers | Sources |
|---|---|
| CAS:1160426-89-0 | ChEBI |
| Citations |
|---|