EMBL-EBI | Chemical Biology Resources | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C33H52O9 |
| Net Charge | 0 |
| Average Mass | 592.770 |
| Monoisotopic Mass | 592.36113 |
| SMILES | [H][C@@]12CC=C3C[C@@H](O[C@@H]4O[C@H](CO)[C@@H](O)[C@H](O)[C@H]4O)CC[C@]3(C)[C@@]1([H])CC[C@@]1(C)[C@@]2([H])C[C@]2([H])O[C@]3(CC[C@@](C)(CO)O3)[C@@H](C)[C@]12[H] |
| InChI | InChI=1S/C33H52O9/c1-17-25-23(41-33(17)12-11-30(2,16-35)42-33)14-22-20-6-5-18-13-19(7-9-31(18,3)21(20)8-10-32(22,25)4)39-29-28(38)27(37)26(36)24(15-34)40-29/h5,17,19-29,34-38H,6-16H2,1-4H3/t17-,19-,20+,21-,22-,23-,24+,25-,26+,27-,28+,29+,30-,31-,32-,33-/m0/s1 |
| InChIKey | QJEQHVALLZCTGC-HPNIRRCESA-N |
| Roles Classification |
|---|
| Biological Role: | metabolite Any intermediate or product resulting from metabolism. The term 'metabolite' subsumes the classes commonly known as primary and secondary metabolites. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| nuatigenin 3-β-D-glucopyranoside (CHEBI:15575) has functional parent nuatigenin (CHEBI:15574) |
| nuatigenin 3-β-D-glucopyranoside (CHEBI:15575) is a monosaccharide derivative (CHEBI:63367) |
| nuatigenin 3-β-D-glucopyranoside (CHEBI:15575) is a steroid saponin (CHEBI:61655) |
| nuatigenin 3-β-D-glucopyranoside (CHEBI:15575) is a β-D-glucoside (CHEBI:22798) |
| IUPAC Name |
|---|
| (22S,25S)-26-hydroxy-22,25-epoxyfurost-5-en-3β-yl β-D-glucopyranoside |
| Synonyms | Source |
|---|---|
| (20S,22S,25S)-22,25-epoxy-26-hydroxyfurost-5-en-3β-yl β-D-glucopyranoside | ChEBI |
| (20S,22S,25S)-22,25-Epoxyfurost-5-ene-3beta,26-diol 3-O-beta-D-glucoside | KEGG COMPOUND |
| UniProt Name | Source |
|---|---|
| nuatigenin 3-β-D-glucopyranoside | UniProt |
| Manual Xrefs | Databases |
|---|---|
| C04859 | KEGG COMPOUND |