EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C26H44N7O17P3S |
| Net Charge | 0 |
| Average Mass | 851.659 |
| Monoisotopic Mass | 851.17272 |
| SMILES | CCCCC(=O)SCCNC(=O)CCNC(=O)[C@H](O)C(C)(C)COP(=O)(O)OP(=O)(O)OC[C@H]1O[C@@H](n2cnc3c(N)ncnc32)[C@H](O)[C@@H]1OP(=O)(O)O |
| InChI | InChI=1S/C26H44N7O17P3S/c1-4-5-6-17(35)54-10-9-28-16(34)7-8-29-24(38)21(37)26(2,3)12-47-53(44,45)50-52(42,43)46-11-15-20(49-51(39,40)41)19(36)25(48-15)33-14-32-18-22(27)30-13-31-23(18)33/h13-15,19-21,25,36-37H,4-12H2,1-3H3,(H,28,34)(H,29,38)(H,42,43)(H,44,45)(H2,27,30,31)(H2,39,40,41)/t15-,19-,20-,21+,25-/m1/s1 |
| InChIKey | RXUATCUKICAIOA-ZMHDXICWSA-N |
| Roles Classification |
|---|
| Chemical Role: | acyl donor Any donor that can transfer acyl groups between molecular entities. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| pentanoyl-CoA (CHEBI:15536) has functional parent coenzyme A (CHEBI:15346) |
| pentanoyl-CoA (CHEBI:15536) has functional parent valeric acid (CHEBI:17418) |
| pentanoyl-CoA (CHEBI:15536) is a short-chain fatty acyl-CoA (CHEBI:61905) |
| pentanoyl-CoA (CHEBI:15536) is conjugate acid of pentanoyl-CoA(4−) (CHEBI:57389) |
| Incoming Relation(s) |
| 5-hydroxypentanoyl-CoA (CHEBI:15501) has functional parent pentanoyl-CoA (CHEBI:15536) |
| pentanoyl-CoA(4−) (CHEBI:57389) is conjugate base of pentanoyl-CoA (CHEBI:15536) |
| IUPAC Name |
|---|
| 3'-phosphoadenosine 5'-(3-{(3R)-3-hydroxy-2,2-dimethyl-4-oxo-4-[(3-oxo-3-{[2-(pentanoylsulfanyl)ethyl]amino}propyl)amino]butyl} dihydrogen diphosphate) |
| Synonyms | Source |
|---|---|
| 5:0-CoA | ChEBI |
| C5:0-CoA | ChEBI |
| coenzyme A S-pentanoate | ChemIDplus |
| S-valeryl-CoA | ChEBI |
| S-Valeryl-coenzym-A | ChEBI |
| S-valeryl-coenzyme-A | ChEBI |
| Manual Xrefs | Databases |
|---|---|
| C00888 | KEGG COMPOUND |
| HMDB0013037 | HMDB |
| Registry Numbers | Sources |
|---|---|
| Reaxys:78329 | Reaxys |
| CAS:4752-33-4 | KEGG COMPOUND |
| CAS:4752-33-4 | ChemIDplus |
| Citations |
|---|