EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C22H36N7O17P3S |
| Net Charge | 0 |
| Average Mass | 795.551 |
| Monoisotopic Mass | 795.11012 |
| SMILES | [H]C(=O)SCCNC(=O)CCNC(=O)[C@H](O)C(C)(C)COP(=O)(O)OP(=O)(O)OC[C@H]1O[C@@H](n2cnc3c(N)ncnc32)[C@H](O)[C@@H]1OP(=O)(O)O |
| InChI | InChI=1S/C22H36N7O17P3S/c1-22(2,17(33)20(34)25-4-3-13(31)24-5-6-50-11-30)8-43-49(40,41)46-48(38,39)42-7-12-16(45-47(35,36)37)15(32)21(44-12)29-10-28-14-18(23)26-9-27-19(14)29/h9-12,15-17,21,32-33H,3-8H2,1-2H3,(H,24,31)(H,25,34)(H,38,39)(H,40,41)(H2,23,26,27)(H2,35,36,37)/t12-,15-,16-,17+,21-/m1/s1 |
| InChIKey | SXMOKYXNAPLNCW-GORZOVPNSA-N |
| Species of Metabolite | Component | Source | Comments |
|---|---|---|---|
| Escherichia coli (ncbitaxon:562) | - | PubMed (21988831) |
| Roles Classification |
|---|
| Chemical Role: | acyl donor Any donor that can transfer acyl groups between molecular entities. |
| Biological Role: | Escherichia coli metabolite Any bacterial metabolite produced during a metabolic reaction in Escherichia coli. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| formyl-CoA (CHEBI:15522) has functional parent formic acid (CHEBI:30751) |
| formyl-CoA (CHEBI:15522) has role Escherichia coli metabolite (CHEBI:76971) |
| formyl-CoA (CHEBI:15522) is a acyl-CoA (CHEBI:17984) |
| formyl-CoA (CHEBI:15522) is conjugate acid of formyl-CoA(4−) (CHEBI:57376) |
| Incoming Relation(s) |
| formyl-CoA(4−) (CHEBI:57376) is conjugate base of formyl-CoA (CHEBI:15522) |
| IUPAC Name |
|---|
| 3'-phosphoadenosine 5'-(3-{(3R)-4-[(3-{[2-(formylsulfanyl)ethyl]amino}-3-oxopropyl)amino]-3-hydroxy-2,2-dimethyl-4-oxobutyl} dihydrogen diphosphate) |
| Synonyms | Source |
|---|---|
| Formyl-CoA | KEGG COMPOUND |
| formyl-coenzyme A | ChEBI |
| Manual Xrefs | Databases |
|---|---|
| C00798 | KEGG COMPOUND |
| FYN | PDBeChem |
| HMDB0003419 | HMDB |
| Registry Numbers | Sources |
|---|---|
| Reaxys:21305801 | Reaxys |
| Citations |
|---|