EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C25H43N8O17P3S |
| Net Charge | 0 |
| Average Mass | 852.647 |
| Monoisotopic Mass | 852.16797 |
| SMILES | C[C@H](N)CC(=O)SCCNC(=O)CCNC(=O)[C@H](O)C(C)(C)COP(=O)(O)OP(=O)(O)OC[C@H]1O[C@@H](n2cnc3c(N)ncnc32)[C@H](O)[C@@H]1OP(=O)(O)O |
| InChI | InChI=1S/C25H43N8O17P3S/c1-13(26)8-16(35)54-7-6-28-15(34)4-5-29-23(38)20(37)25(2,3)10-47-53(44,45)50-52(42,43)46-9-14-19(49-51(39,40)41)18(36)24(48-14)33-12-32-17-21(27)30-11-31-22(17)33/h11-14,18-20,24,36-37H,4-10,26H2,1-3H3,(H,28,34)(H,29,38)(H,42,43)(H,44,45)(H2,27,30,31)(H2,39,40,41)/t13-,14+,18+,19+,20-,24+/m0/s1 |
| InChIKey | CCSDHAPTHIKZLY-VKBDFPRVSA-N |
| Roles Classification |
|---|
| Chemical Role: | acyl donor Any donor that can transfer acyl groups between molecular entities. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| L-3-aminobutanoyl-CoA (CHEBI:15512) is a 3-aminobutyryl-CoA (CHEBI:28317) |
| L-3-aminobutanoyl-CoA (CHEBI:15512) is conjugate acid of L-3-aminobutanoyl-CoA(3−) (CHEBI:57366) |
| Incoming Relation(s) |
| L-3-aminobutanoyl-CoA(3−) (CHEBI:57366) is conjugate base of L-3-aminobutanoyl-CoA (CHEBI:15512) |
| IUPAC Name |
|---|
| 3'-phosphoadenosine 5'-{3-[(3R)-4-{[3-({2-[(L-3-aminobutanoyl)sulfanyl]ethyl}amino)-3-oxopropyl]amino}-3-hydroxy-2,2-dimethyl-4-oxobutyl] dihydrogen diphosphate} |
| Synonyms | Source |
|---|---|
| L-3-Aminobutyryl-CoA | KEGG COMPOUND |
| S-(L-3-aminobutanoyl)-coenzyme A | ChEBI |
| L-3-aminobutyryl-coenzyme A | ChEBI |
| L-3-aminobutanoyl-coenzyme A | ChEBI |
| Manual Xrefs | Databases |
|---|---|
| C05231 | KEGG COMPOUND |