EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C10H12N2O4 |
| Net Charge | 0 |
| Average Mass | 224.216 |
| Monoisotopic Mass | 224.07971 |
| SMILES | Nc1c(O)cccc1C(=O)CC(N)C(=O)O |
| InChI | InChI=1S/C10H12N2O4/c11-6(10(15)16)4-8(14)5-2-1-3-7(13)9(5)12/h1-3,6,13H,4,11-12H2,(H,15,16) |
| InChIKey | VCKPUUFAIGNJHC-UHFFFAOYSA-N |
| Roles Classification |
|---|
| Chemical Roles: | Bronsted base A molecular entity capable of accepting a hydron from a donor (Brønsted acid). Bronsted acid A molecular entity capable of donating a hydron to an acceptor (Brønsted base). |
| Biological Role: | human metabolite Any mammalian metabolite produced during a metabolic reaction in humans (Homo sapiens). |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| 3-hydroxykynurenine (CHEBI:1547) has role human metabolite (CHEBI:77746) |
| 3-hydroxykynurenine (CHEBI:1547) is a hydroxykynurenine (CHEBI:86497) |
| Incoming Relation(s) |
| 3-hydroxy-L-kynurenine (CHEBI:17380) is a 3-hydroxykynurenine (CHEBI:1547) |
| IUPAC Name |
|---|
| 3-(2-amino-3-hydroxybenzoyl)alanine |
| Synonyms | Source |
|---|---|
| 3-Hydroxykynurenine | KEGG COMPOUND |
| 2-amino-4-(2-amino-3-hydroxyphenyl)-4-oxobutanoic acid | IUPAC |
| 3-(3-hydroxyanthraniloyl)alanine | ChemIDplus |
| 3-Hydroxy-DL-kynurenine | KEGG COMPOUND |
| Manual Xrefs | Databases |
|---|---|
| C02794 | KEGG COMPOUND |
| HMDB0000732 | HMDB |
| Registry Numbers | Sources |
|---|---|
| Reaxys:2697635 | Reaxys |
| CAS:484-78-6 | ChemIDplus |
| Citations |
|---|