EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C9H18N4O4 |
| Net Charge | 0 |
| Average Mass | 246.267 |
| Monoisotopic Mass | 246.13281 |
| SMILES | N=C(N)NCCC[C@H](NCCC(=O)O)C(=O)O |
| InChI | InChI=1S/C9H18N4O4/c10-9(11)13-4-1-2-6(8(16)17)12-5-3-7(14)15/h6,12H,1-5H2,(H,14,15)(H,16,17)(H4,10,11,13)/t6-/m0/s1 |
| InChIKey | OHWCFZJEIHZWMN-LURJTMIESA-N |
| Roles Classification |
|---|
| Chemical Roles: | Bronsted base A molecular entity capable of accepting a hydron from a donor (Brønsted acid). Bronsted acid A molecular entity capable of donating a hydron to an acceptor (Brønsted base). |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| N2-(2-carboxyethyl)-L-arginine (CHEBI:15427) is a amino dicarboxylic acid (CHEBI:36164) |
| N2-(2-carboxyethyl)-L-arginine (CHEBI:15427) is a guanidines (CHEBI:24436) |
| N2-(2-carboxyethyl)-L-arginine (CHEBI:15427) is a α-N-substituted L-arginine (CHEBI:22440) |
| N2-(2-carboxyethyl)-L-arginine (CHEBI:15427) is tautomer of N2-(2-carboxyethyl)-L-arginine dizwitterion (CHEBI:57304) |
| Incoming Relation(s) |
| N2-(2-carboxyethyl)-L-arginine dizwitterion (CHEBI:57304) is tautomer of N2-(2-carboxyethyl)-L-arginine (CHEBI:15427) |
| IUPAC Name |
|---|
| N2-(2-carboxyethyl)-L-arginine |
| Synonyms | Source |
|---|---|
| N2-(2-carboxyethyl)arginine | ChEBI |
| L-N2-(2-Carboxyethyl)arginine | KEGG COMPOUND |
| N2-(2-Carboxyethyl)-L-arginine | KEGG COMPOUND |
| Citations |
|---|