EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
CHEBI:15421 - perillyl aldehyde
| Formula | C10H14O |
| Net Charge | 0 |
| Average Mass | 150.221 |
| Monoisotopic Mass | 150.10447 |
| SMILES | [H]C(=O)C1=CCC(C(=C)C)CC1 |
| InChI | InChI=1S/C10H14O/c1-8(2)10-5-3-9(7-11)4-6-10/h3,7,10H,1,4-6H2,2H3 |
| InChIKey | RUMOYJJNUMEFDD-UHFFFAOYSA-N |
| Species of Metabolite | Component | Source | Comments |
|---|---|---|---|
| Homo sapiens (ncbitaxon:9606) | - | DOI (10.1038/nbt.2488) | |
| Mus musculus (ncbitaxon:10090) | - | PubMed (19425150) | Source: BioModels - MODEL1507180067 |
| Roles Classification |
|---|
| Biological Roles: | human metabolite Any mammalian metabolite produced during a metabolic reaction in humans (Homo sapiens). mouse metabolite Any mammalian metabolite produced during a metabolic reaction in a mouse (Mus musculus). volatile oil component Any plant metabolite that is found naturally as a component of a volatile oil. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| perillyl aldehyde (CHEBI:15421) has role human metabolite (CHEBI:77746) |
| perillyl aldehyde (CHEBI:15421) has role mouse metabolite (CHEBI:75771) |
| perillyl aldehyde (CHEBI:15421) has role volatile oil component (CHEBI:27311) |
| perillyl aldehyde (CHEBI:15421) is a aldehyde (CHEBI:17478) |
| perillyl aldehyde (CHEBI:15421) is a olefinic compound (CHEBI:78840) |
| IUPAC Name |
|---|
| 4-(prop-1-en-2-yl)cyclohex-1-ene-1-carbaldehyde |
| Synonyms | Source |
|---|---|
| Perillyl aldehyde | KEGG COMPOUND |
| Perillaldehyde | KEGG COMPOUND |
| perillylaldehyde | ChEBI |
| 4-(1-methylethenyl)-1-cyclohexene1-carboxyaldehyde | ChEBI |
| p-mentha-1,8-dien-7-al | NIST Chemistry WebBook |
| perillic aldehyde | ChemIDplus |
| UniProt Name | Source |
|---|---|
| perillyl aldehyde | UniProt |
| Citations |
|---|