EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C20H30O2 |
| Net Charge | 0 |
| Average Mass | 302.458 |
| Monoisotopic Mass | 302.22458 |
| SMILES | [H][C@]12CC[C@]34CC(=C)[C@H](CC[C@@]3([H])[C@]1(C)CCC[C@@]2(C)C(=O)O)C4 |
| InChI | InChI=1S/C20H30O2/c1-13-11-20-10-7-15-18(2,16(20)6-5-14(13)12-20)8-4-9-19(15,3)17(21)22/h14-16H,1,4-12H2,2-3H3,(H,21,22)/t14-,15+,16+,18-,19-,20-/m1/s1 |
| InChIKey | NIKHGUQULKYIGE-OTCXFQBHSA-N |
| Roles Classification |
|---|
| Biological Roles: | anti-HIV-1 agent An anti-HIV agent that destroys or inhibits the replication of HIV-1, the more infective and more virulent of the two types of HIV virus. plant metabolite Any eukaryotic metabolite produced during a metabolic reaction in plants, the kingdom that include flowering plants, conifers and other gymnosperms. |
| Application: | antineoplastic agent A substance that inhibits or prevents the proliferation of neoplasms. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| ent-kaur-16-en-19-oic acid (CHEBI:15417) has role anti-HIV-1 agent (CHEBI:64947) |
| ent-kaur-16-en-19-oic acid (CHEBI:15417) has role antineoplastic agent (CHEBI:35610) |
| ent-kaur-16-en-19-oic acid (CHEBI:15417) has role plant metabolite (CHEBI:76924) |
| ent-kaur-16-en-19-oic acid (CHEBI:15417) is a ent-kaurane diterpenoid (CHEBI:36760) |
| ent-kaur-16-en-19-oic acid (CHEBI:15417) is conjugate acid of ent-kaur-16-en-19-oate (CHEBI:57297) |
| Incoming Relation(s) |
| ent-kaur-16-en-19-oate (CHEBI:57297) is conjugate base of ent-kaur-16-en-19-oic acid (CHEBI:15417) |
| IUPAC Name |
|---|
| ent-kaur-16-en-19-oic acid |
| Synonyms | Source |
|---|---|
| (5β,8α,9β,10α,13α)-kaur-16-en-18-oic acid | IUPAC |
| ent-Kaur-16(17)-en-19-oic acid | KEGG COMPOUND |
| ent-Kaurenoic acid | KEGG COMPOUND |
| Kaur-16-en-18-oic acid | KEGG COMPOUND |
| (-)-Kaur-16-en-19-oic acid | KEGG COMPOUND |
| Kauren-19-oic acid | ChemIDplus |
| Manual Xrefs | Databases |
|---|---|
| C00000881 | KNApSAcK |
| C11874 | KEGG COMPOUND |
| CPD1F-132 | MetaCyc |
| LMPR0104130004 | LIPID MAPS |
| Registry Numbers | Sources |
|---|---|
| Reaxys:10784819 | Reaxys |
| CAS:6730-83-2 | KEGG COMPOUND |
| CAS:6730-83-2 | ChemIDplus |
| Citations |
|---|