EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
CHEBI:15405 - (−)-endo-fenchol
| Formula | C10H18O |
| Net Charge | 0 |
| Average Mass | 154.253 |
| Monoisotopic Mass | 154.13577 |
| SMILES | CC1(C)[C@@H]2CC[C@@](C)(C2)[C@@H]1O |
| InChI | InChI=1S/C10H18O/c1-9(2)7-4-5-10(3,6-7)8(9)11/h7-8,11H,4-6H2,1-3H3/t7-,8-,10+/m1/s1 |
| InChIKey | IAIHUHQCLTYTSF-MRTMQBJTSA-N |
| Roles Classification |
|---|
| Biological Roles: | volatile oil component Any plant metabolite that is found naturally as a component of a volatile oil. plant metabolite Any eukaryotic metabolite produced during a metabolic reaction in plants, the kingdom that include flowering plants, conifers and other gymnosperms. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| (−)-endo-fenchol (CHEBI:15405) has role plant metabolite (CHEBI:76924) |
| (−)-endo-fenchol (CHEBI:15405) has role volatile oil component (CHEBI:27311) |
| (−)-endo-fenchol (CHEBI:15405) is a carbobicyclic compound (CHEBI:36785) |
| (−)-endo-fenchol (CHEBI:15405) is a fenchane monoterpenoid (CHEBI:36739) |
| IUPAC Name |
|---|
| (1S,2S,4R)-1,3,3-trimethylbicyclo[2.2.1]heptan-2-ol |
| Synonyms | Source |
|---|---|
| 1,3,3-trimethyl-2-norbornanol | ChEBI |
| (1S,2-endo)-1,3,3-trimethylnorbornan-2-ol | JCBN |
| 2-Fenchanol | KEGG COMPOUND |
| (-)-endo-Fenchol | KEGG COMPOUND |
| (-)-endo-Fenchol | KEGG COMPOUND |
| Fenchyl alcohol | KEGG COMPOUND |
| UniProt Name | Source |
|---|---|
| (1S,2S,4R)-endo-fenchol | UniProt |
| Manual Xrefs | Databases |
|---|---|
| C00035801 | KNApSAcK |
| C02344 | KEGG COMPOUND |
| CPD-685 | MetaCyc |
| HMDB0034932 | HMDB |
| LMPR0102120005 | LIPID MAPS |
| Citations |
|---|