EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C14H12O2 |
| Net Charge | 0 |
| Average Mass | 212.248 |
| Monoisotopic Mass | 212.08373 |
| SMILES | O[C@@H]1c2c(ccc3ccccc23)C=C[C@@H]1O |
| InChI | InChI=1S/C14H12O2/c15-12-8-7-10-6-5-9-3-1-2-4-11(9)13(10)14(12)16/h1-8,12,14-16H/t12-,14-/m0/s1 |
| InChIKey | FOTICWSJABVKPW-JSGCOSHPSA-N |
| Species of Metabolite | Component | Source | Comments |
|---|---|---|---|
| Mus musculus (ncbitaxon:10090) | - | PubMed (19425150) | Source: BioModels - MODEL1507180067 |
| Roles Classification |
|---|
| Biological Roles: | mouse metabolite Any mammalian metabolite produced during a metabolic reaction in a mouse (Mus musculus). xenobiotic A xenobiotic (Greek, xenos "foreign"; bios "life") is a compound that is foreign to a living organism. Principal xenobiotics include: drugs, carcinogens and various compounds that have been introduced into the environment by artificial means. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| (3S,4R)-3,4-dihydrophenanthrene-3,4-diol (CHEBI:15386) has role mouse metabolite (CHEBI:75771) |
| (3S,4R)-3,4-dihydrophenanthrene-3,4-diol (CHEBI:15386) is a cis-3,4-dihydrophenanthrene-3,4-diol (CHEBI:23286) |
| (3S,4R)-3,4-dihydrophenanthrene-3,4-diol (CHEBI:15386) is enantiomer of (3R,4S)-3,4-dihydrophenanthrene-3,4-diol (CHEBI:37465) |
| Incoming Relation(s) |
| (3R,4S)-3,4-dihydrophenanthrene-3,4-diol (CHEBI:37465) is enantiomer of (3S,4R)-3,4-dihydrophenanthrene-3,4-diol (CHEBI:15386) |
| IUPAC Names |
|---|
| (+)-cis-3,4-dihydrophenanthrene-3,4-diol |
| (3S,4R)-3,4-dihydrophenanthrene-3,4-diol |
| Synonyms | Source |
|---|---|
| (+)-cis-3,4-Dihydrophenanthrene-3,4-diol | KEGG COMPOUND |
| cis-3,4-Dihydroxy-3,4-dihydrophenanthrene | KEGG COMPOUND |
| UniProt Name | Source |
|---|---|
| (3S,4R)-3,4-dihydrophenanthrene-3,4-diol | UniProt |
| Manual Xrefs | Databases |
|---|---|
| C04468 | KEGG COMPOUND |
| Registry Numbers | Sources |
|---|---|
| Beilstein:1912842 | Beilstein |
| Beilstein:5264943 | Beilstein |