EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C9H15N5O4 |
| Net Charge | 0 |
| Average Mass | 257.250 |
| Monoisotopic Mass | 257.11240 |
| SMILES | CC(O)C(O)C1CNC2=NC(N)=NC(=O)C2(O)N1 |
| InChI | InChI=1S/C9H15N5O4/c1-3(15)5(16)4-2-11-6-9(18,14-4)7(17)13-8(10)12-6/h3-5,14-16,18H,2H2,1H3,(H3,10,11,12,13,17) |
| InChIKey | KJKIEFUPAPPGBC-UHFFFAOYSA-N |
| Species of Metabolite | Component | Source | Comments |
|---|---|---|---|
| Homo sapiens (ncbitaxon:9606) | - | DOI (10.1038/nbt.2488) |
| Roles Classification |
|---|
| Chemical Role: | Bronsted base A molecular entity capable of accepting a hydron from a donor (Brønsted acid). |
| Biological Role: | human metabolite Any mammalian metabolite produced during a metabolic reaction in humans (Homo sapiens). |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| 4a-hydroxytetrahydrobiopterin (CHEBI:15374) has functional parent 5,6,7,8-tetrahydrobiopterin (CHEBI:15372) |
| 4a-hydroxytetrahydrobiopterin (CHEBI:15374) has role human metabolite (CHEBI:77746) |
| 4a-hydroxytetrahydrobiopterin (CHEBI:15374) is a hemiaminal (CHEBI:73080) |
| 4a-hydroxytetrahydrobiopterin (CHEBI:15374) is a tetrahydropterin (CHEBI:30436) |
| Incoming Relation(s) |
| 4a-hydroxy-L-erythro-5,6,7,8-tetrahydrobiopterin (CHEBI:15642) is a 4a-hydroxytetrahydrobiopterin (CHEBI:15374) |
| IUPAC Name |
|---|
| 2-amino-6-(1,2-dihydroxypropyl)-4a-hydroxy-5,6,7,8-tetrahydropteridin-4(4aH)-one |
| Synonym | Source |
|---|---|
| 4a-Hydroxy-5,6,4,8-tetrahydrobiopterin | KEGG COMPOUND |
| Manual Xrefs | Databases |
|---|---|
| CPD-5881 | MetaCyc |
| Registry Numbers | Sources |
|---|---|
| CAS:70110-58-6 | ChemIDplus |
| Citations |
|---|