EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C13H18O7 |
| Net Charge | 0 |
| Average Mass | 286.280 |
| Monoisotopic Mass | 286.10525 |
| SMILES | OC[C@H]1O[C@@H](OCc2ccccc2O)[C@H](O)[C@@H](O)[C@@H]1O |
| InChI | InChI=1S/C13H18O7/c14-5-9-10(16)11(17)12(18)13(20-9)19-6-7-3-1-2-4-8(7)15/h1-4,9-18H,5-6H2/t9-,10-,11+,12-,13-/m1/s1 |
| InChIKey | VBSPBYNZPRRGSB-UJPOAAIJSA-N |
| Species of Metabolite | Component | Source | Comments |
|---|---|---|---|
| Filipendula ulmaria (ncbitaxon:57917) | flower (BTO:0000469) | Article (Book: Dictionary of Food Compounds with CD-ROM: Additives, Flavors, and Ingredients, Shmuel Yannai, CRC Press, 2003, pg 771, I-161.) |
| Roles Classification |
|---|
| Biological Role: | plant metabolite Any eukaryotic metabolite produced during a metabolic reaction in plants, the kingdom that include flowering plants, conifers and other gymnosperms. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| β-isosalicin (CHEBI:153572) has role plant metabolite (CHEBI:76924) |
| β-isosalicin (CHEBI:153572) is a monosaccharide derivative (CHEBI:63367) |
| β-isosalicin (CHEBI:153572) is a phenols (CHEBI:33853) |
| β-isosalicin (CHEBI:153572) is a β-D-glucoside (CHEBI:22798) |
| IUPAC Name |
|---|
| 2-hydroxybenzyl β-D-glucopyranoside |
| Synonyms | Source |
|---|---|
| (2-hydroxyphenyl)methyl β-D-glucopyranoside | IUPAC |
| (2R,3R,4S,5S,6R)-2-[(2-hydroxybenzyl)oxy]-6-(hydroxymethyl)tetrahydro-2H-pyran-3,4,5-triol | ChEBI |
| 2-(β-D-glucopyranosyloxymethyl)phenol | ChEBI |
| isosalicin | ChEBI |
| Manual Xrefs | Databases |
|---|---|
| FDB012261 | FooDB |
| HMDB0034023 | HMDB |
| Registry Numbers | Sources |
|---|---|
| CAS:7724-09-6 | ChEBI |
| Citations |
|---|