EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C9H13N |
| Net Charge | 0 |
| Average Mass | 135.210 |
| Monoisotopic Mass | 135.10480 |
| SMILES | CCC(N)c1ccccc1 |
| InChI | InChI=1S/C9H13N/c1-2-9(10)8-6-4-3-5-7-8/h3-7,9H,2,10H2,1H3 |
| InChIKey | AQFLVLHRZFLDDV-UHFFFAOYSA-N |
| Roles Classification |
|---|
| Chemical Role: | Bronsted base A molecular entity capable of accepting a hydron from a donor (Brønsted acid). |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| 1-phenylpropan-1-amine (CHEBI:153571) is a benzenes (CHEBI:22712) |
| 1-phenylpropan-1-amine (CHEBI:153571) is a phenylalkylamine (CHEBI:60977) |
| 1-phenylpropan-1-amine (CHEBI:153571) is a primary amino compound (CHEBI:50994) |
| 1-phenylpropan-1-amine (CHEBI:153571) is conjugate base of 1-phenylpropan-1-aminium (CHEBI:150015) |
| Incoming Relation(s) |
| 1-phenylpropan-1-aminium (CHEBI:150015) is conjugate acid of 1-phenylpropan-1-amine (CHEBI:153571) |
| IUPAC Name |
|---|
| 1-phenylpropan-1-amine |
| Synonyms | Source |
|---|---|
| 1-phenyl-1-propanamine | ChEBI |
| 1-phenylpropylamine | ChemIDplus |
| α-ethylbenzylamine | ChemIDplus |
| α-phenylpropylamine | ChemIDplus |
| α-ethylbenzenemethanamine | NIST Chemistry WebBook |
| Citations |
|---|