EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C6H12O6 |
| Net Charge | 0 |
| Average Mass | 180.156 |
| Monoisotopic Mass | 180.06339 |
| SMILES | OC[C@H](O)[C@H]1O[C@@H](O)[C@H](O)[C@H]1O |
| WURCS | WURCS=2.0/1,1,0/[a2121h-1a_1-4]/1/ |
| InChI | InChI=1S/C6H12O6/c7-1-2(8)5-3(9)4(10)6(11)12-5/h2-11H,1H2/t2-,3+,4+,5+,6+/m0/s1 |
| InChIKey | AVVWPBAENSWJCB-YDMGZANHSA-N |
| Roles Classification |
|---|
| Biological Role: | metabolite Any intermediate or product resulting from metabolism. The term 'metabolite' subsumes the classes commonly known as primary and secondary metabolites. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| α-L-idofuranose (CHEBI:153554) is a L-idofuranose (CHEBI:152858) |
| α-L-idofuranose (CHEBI:153554) is enantiomer of α-D-idofuranose (CHEBI:153617) |
| Incoming Relation(s) |
| α-D-idofuranose (CHEBI:153617) is enantiomer of α-L-idofuranose (CHEBI:153554) |
| IUPAC Names |
|---|
| a-Idof |
| α-L-idofuranose |
| Synonym | Source |
|---|---|
| alpha-L-ido-hexofuranose | IUPAC |
| Manual Xrefs | Databases |
|---|---|
| G73728WQ | GlyTouCan |
| Registry Numbers | Sources |
|---|---|
| CAS:41847-65-8 | ChemIDplus |