EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C12H6O2 |
| Net Charge | 0 |
| Average Mass | 182.178 |
| Monoisotopic Mass | 182.03678 |
| SMILES | O=C1C(=O)c2cccc3cccc1c23 |
| InChI | InChI=1S/C12H6O2/c13-11-8-5-1-3-7-4-2-6-9(10(7)8)12(11)14/h1-6H |
| InChIKey | AFPRJLBZLPBTPZ-UHFFFAOYSA-N |
| Wikipedia |
|---|
| Roles Classification |
|---|
| Chemical Role: | chain carrier The role played by a molecular entity, such as an atom or free radical, which is involved in chain-propagating reactions. |
| Biological Role: | epitope The biological role played by a material entity when bound by a receptor of the adaptive immune system. Specific site on an antigen to which an antibody binds. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| acenaphthoquinone (CHEBI:15342) has parent hydride acenaphthene (CHEBI:22154) |
| acenaphthoquinone (CHEBI:15342) has role chain carrier (CHEBI:53431) |
| acenaphthoquinone (CHEBI:15342) has role epitope (CHEBI:53000) |
| acenaphthoquinone (CHEBI:15342) is a orthoquinones (CHEBI:25622) |
| IUPAC Names |
|---|
| acenaphthene-1,2-dione |
| acenaphthylene-1,2-dione |
| Synonyms | Source |
|---|---|
| 1,2-acenaphthenedione | NIST Chemistry WebBook |
| 1,2-acenaphthenequinone | ChemIDplus |
| 1,2-acenaphthylenedione | NIST Chemistry WebBook |
| 1,2-Diketoacenaphthene | KEGG COMPOUND |
| acenaphthene-1,2-dione | ChEBI |
| acenaphthene quinone | ChEBI |
| UniProt Name | Source |
|---|---|
| acenaphthene-1,2-dione | UniProt |
| Citations |
|---|