EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C6H11NO4 |
| Net Charge | 0 |
| Average Mass | 161.157 |
| Monoisotopic Mass | 161.06881 |
| SMILES | CC(NCCC(=O)O)C(=O)O |
| InChI | InChI=1S/C6H11NO4/c1-4(6(10)11)7-3-2-5(8)9/h4,7H,2-3H2,1H3,(H,8,9)(H,10,11) |
| InChIKey | OAWHMSFCLIYBHE-UHFFFAOYSA-N |
| Roles Classification |
|---|
| Chemical Roles: | Bronsted base A molecular entity capable of accepting a hydron from a donor (Brønsted acid). Bronsted acid A molecular entity capable of donating a hydron to an acceptor (Brønsted base). |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| β-alanopine (CHEBI:15337) has functional parent propionic acid (CHEBI:30768) |
| β-alanopine (CHEBI:15337) is a amino dicarboxylic acid (CHEBI:36164) |
| Incoming Relation(s) |
| (R)-β-alanopine (CHEBI:50531) is a β-alanopine (CHEBI:15337) |
| (S)-β-alanopine (CHEBI:50532) is a β-alanopine (CHEBI:15337) |
| IUPAC Name |
|---|
| N-(2-carboxyethyl)alanine |
| Synonyms | Source |
|---|---|
| beta-Alanopine | KEGG COMPOUND |
| 2-[(2-carboxyethyl)amino]propanoic acid | IUPAC |
| Manual Xrefs | Databases |
|---|---|
| C02207 | KEGG COMPOUND |
| Registry Numbers | Sources |
|---|---|
| Beilstein:1773072 | Beilstein |