EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
CHEBI:15336 - agaritine
| Formula | C12H17N3O4 |
| Net Charge | 0 |
| Average Mass | 267.285 |
| Monoisotopic Mass | 267.12191 |
| SMILES | N[C@@H](CCC(=O)NNc1ccc(CO)cc1)C(=O)O |
| InChI | InChI=1S/C12H17N3O4/c13-10(12(18)19)5-6-11(17)15-14-9-3-1-8(7-16)2-4-9/h1-4,10,14,16H,5-7,13H2,(H,15,17)(H,18,19)/t10-/m0/s1 |
| InChIKey | SRSPQXBFDCGXIZ-JTQLQIEISA-N |
| Roles Classification |
|---|
| Chemical Roles: | Bronsted base A molecular entity capable of accepting a hydron from a donor (Brønsted acid). Bronsted acid A molecular entity capable of donating a hydron to an acceptor (Brønsted base). |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| agaritine (CHEBI:15336) is a L-glutamic acid derivative (CHEBI:83982) |
| agaritine (CHEBI:15336) is a benzyl alcohols (CHEBI:22743) |
| agaritine (CHEBI:15336) is a carbohydrazide (CHEBI:35363) |
| agaritine (CHEBI:15336) is a non-proteinogenic L-α-amino acid (CHEBI:83822) |
| agaritine (CHEBI:15336) is tautomer of agaritine zwitterion (CHEBI:57285) |
| Incoming Relation(s) |
| agaritine zwitterion (CHEBI:57285) is tautomer of agaritine (CHEBI:15336) |
| IUPAC Name |
|---|
| 2-[4-(hydroxymethyl)phenyl]-L-glutamohydrazide |
| Synonyms | Source |
|---|---|
| Agaritine | KEGG COMPOUND |
| (2S)-2-amino-5-{2-[4-(hydroxymethyl)phenyl]hydrazino}-5-oxopentanoic acid | ChEBI |
| L-glutamic acid, 5-(2-(4-(hydroxymethyl)phenyl)hydrazide) | ChemIDplus |
| β-N-[γ-L(+)-glutamyl]-4-hydroxymethylphenylhydrazine | ChEBI |