EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
CHEBI:17380 - 3-hydroxy-L-kynurenine
| Formula | C10H12N2O4 |
| Net Charge | 0 |
| Average Mass | 224.216 |
| Monoisotopic Mass | 224.07971 |
| SMILES | Nc1c(O)cccc1C(=O)C[C@H](N)C(=O)O |
| InChI | InChI=1S/C10H12N2O4/c11-6(10(15)16)4-8(14)5-2-1-3-7(13)9(5)12/h1-3,6,13H,4,11-12H2,(H,15,16)/t6-/m0/s1 |
| InChIKey | VCKPUUFAIGNJHC-LURJTMIESA-N |
| Species of Metabolite | Component | Source | Comments |
|---|---|---|---|
| Homo sapiens (ncbitaxon:9606) | - | DOI (10.1038/nbt.2488) | |
| Saccharomyces cerevisiae (ncbitaxon:4932) | |||
| - | PubMed (4266242) | ||
| - | PubMed (24678285) | Source: yeast.sf.net | |
| Mus musculus (ncbitaxon:10090) | - | PubMed (19425150) | Source: BioModels - MODEL1507180067 |
| Roles Classification |
|---|
| Chemical Roles: | Bronsted base A molecular entity capable of accepting a hydron from a donor (Brønsted acid). Bronsted acid A molecular entity capable of donating a hydron to an acceptor (Brønsted base). Bronsted base A molecular entity capable of accepting a hydron from a donor (Brønsted acid). Bronsted acid A molecular entity capable of donating a hydron to an acceptor (Brønsted base). |
| Biological Roles: | Saccharomyces cerevisiae metabolite Any fungal metabolite produced during a metabolic reaction in Baker's yeast (Saccharomyces cerevisiae ). mouse metabolite Any mammalian metabolite produced during a metabolic reaction in a mouse (Mus musculus). human metabolite Any mammalian metabolite produced during a metabolic reaction in humans (Homo sapiens). |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| 3-hydroxy-L-kynurenine (CHEBI:17380) has role Saccharomyces cerevisiae metabolite (CHEBI:75772) |
| 3-hydroxy-L-kynurenine (CHEBI:17380) has role mouse metabolite (CHEBI:75771) |
| 3-hydroxy-L-kynurenine (CHEBI:17380) is a 3-hydroxykynurenine (CHEBI:1547) |
| 3-hydroxy-L-kynurenine (CHEBI:17380) is tautomer of 3-hydroxy-L-kynurenine zwitterion (CHEBI:58125) |
| Incoming Relation(s) |
| 3-hydroxy-L-kynurenine zwitterion (CHEBI:58125) is tautomer of 3-hydroxy-L-kynurenine (CHEBI:17380) |
| IUPAC Name |
|---|
| 3-(2-amino-3-hydroxybenzoyl)-L-alanine |
| Synonyms | Source |
|---|---|
| 3-Hydroxy-L-kynurenine | KEGG COMPOUND |
| (2S)-2-amino-4-(2-amino-3-hydroxyphenyl)-4-oxobutanoic acid | IUPAC |
| L-3-hydroxykynurenine | ChemIDplus |
| 3-(3-hydroxyanthraniloyl)-L-alanine | ChemIDplus |