EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C46H77NO17 |
| Net Charge | 0 |
| Average Mass | 916.112 |
| Monoisotopic Mass | 915.51915 |
| SMILES | CC[C@H]1OC(=O)C[C@@H](O)[C@H](C)[C@@H](O[C@@H]2O[C@H](C)[C@@H](O[C@H]3C[C@@](C)(O)[C@@H](O)[C@H](C)O3)[C@H](N(C)C)[C@H]2O)[C@@H](CC=O)C[C@@H](C)C(=O)/C=C/C(C)=C/[C@@H]1CO[C@@H]1O[C@H](C)[C@@H](O)[C@@H](OC)[C@H]1OC |
| InChI | InChI=1S/C46H77NO17/c1-13-33-30(22-58-45-42(57-12)41(56-11)37(52)26(5)60-45)18-23(2)14-15-31(49)24(3)19-29(16-17-48)39(25(4)32(50)20-34(51)62-33)64-44-38(53)36(47(9)10)40(27(6)61-44)63-35-21-46(8,55)43(54)28(7)59-35/h14-15,17-18,24-30,32-33,35-45,50,52-55H,13,16,19-22H2,1-12H3/b15-14+,23-18+/t24-,25+,26-,27-,28+,29+,30-,32-,33-,35+,36-,37-,38-,39-,40-,41-,42-,43+,44+,45-,46-/m1/s1 |
| InChIKey | WBPYTXDJUQJLPQ-VMXQISHHSA-N |
| Wikipedia |
|---|
| Roles Classification |
|---|
| Chemical Role: | environmental contaminant Any minor or unwanted substance introduced into the environment that can have undesired effects. |
| Biological Roles: | xenobiotic A xenobiotic (Greek, xenos "foreign"; bios "life") is a compound that is foreign to a living organism. Principal xenobiotics include: drugs, carcinogens and various compounds that have been introduced into the environment by artificial means. allergen A chemical compound, or part thereof, which causes the onset of an allergic reaction by interacting with any of the molecular pathways involved in an allergy. bacterial metabolite Any prokaryotic metabolite produced during a metabolic reaction in bacteria. bacterial metabolite Any prokaryotic metabolite produced during a metabolic reaction in bacteria. antimicrobial agent A substance that kills or slows the growth of microorganisms, including bacteria, viruses, fungi and protozoans. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| tylosin (CHEBI:17658) has functional parent tylactone (CHEBI:29700) |
| tylosin (CHEBI:17658) has role allergen (CHEBI:50904) |
| tylosin (CHEBI:17658) has role bacterial metabolite (CHEBI:76969) |
| tylosin (CHEBI:17658) has role environmental contaminant (CHEBI:78298) |
| tylosin (CHEBI:17658) has role xenobiotic (CHEBI:35703) |
| tylosin (CHEBI:17658) is a aldehyde (CHEBI:17478) |
| tylosin (CHEBI:17658) is a disaccharide derivative (CHEBI:63353) |
| tylosin (CHEBI:17658) is a enone (CHEBI:51689) |
| tylosin (CHEBI:17658) is a leucomycin (CHEBI:25022) |
| tylosin (CHEBI:17658) is a macrolide antibiotic (CHEBI:25105) |
| tylosin (CHEBI:17658) is a monosaccharide derivative (CHEBI:63367) |
| tylosin (CHEBI:17658) is conjugate base of tylosin(1+) (CHEBI:77047) |
| Incoming Relation(s) |
| tylosin(1+) (CHEBI:77047) is conjugate acid of tylosin (CHEBI:17658) |
| IUPAC Name |
|---|
| [(2R,3R,4E,6E,9R,11R,12S,13S,14R)-12-[3,6-dideoxy-4-O-(2,6-dideoxy-3-C-methyl-α-L-ribo-hexopyranosyl)-3-(dimethylamino)-β-D-glucopyranosyloxy]-2-ethyl-14-hydroxy-5,9,13-trimethyl-8,16-dioxo-11-(2-oxoethyl)oxacyclohexadeca-4,6-dien-3-yl]methyl 6-deoxy-2,3-di-O-methyl-β-D-allopyranoside |
| INNs | Source |
|---|---|
| tylosin | ChemIDplus |
| tilosina | ChemIDplus |
| tylosine | ChemIDplus |
| tylosinum | ChemIDplus |
| Synonyms | Source |
|---|---|
| Tylosin | KEGG COMPOUND |
| Tylan | ChemIDplus |
| Tylocine | ChemIDplus |
| Tylosin A | ChemIDplus |
| Manual Xrefs | Databases |
|---|---|
| C01457 | KEGG COMPOUND |
| TYK | PDBeChem |
| LMPK04000004 | LIPID MAPS |
| US2004082524 | Patent |
| TYLOSIN | MetaCyc |
| HMDB0034108 | HMDB |
| D02490 | KEGG DRUG |
| Tylosin | Wikipedia |
| Registry Numbers | Sources |
|---|---|
| Reaxys:4651020 | Reaxys |
| CAS:1401-69-0 | KEGG COMPOUND |
| CAS:1401-69-0 | ChemIDplus |
| Citations |
|---|