EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | H3O9P3 |
| Net Charge | 0 |
| Average Mass | 239.937 |
| Monoisotopic Mass | 239.89899 |
| SMILES | O=P1(O)OP(=O)(O)OP(=O)(O)O1 |
| InChI | InChI=1S/H3O9P3/c1-10(2)7-11(3,4)9-12(5,6)8-10/h(H,1,2)(H,3,4)(H,5,6) |
| InChIKey | AZSFNUJOCKMOGB-UHFFFAOYSA-N |
| Roles Classification |
|---|
| Chemical Roles: | inorganic acid A Brønsted acid derived from one or more inorganic compounds. Inorganic acids (also known as mineral acids) form hydrons and conjugate base ions when dissolved in water. Bronsted acid A molecular entity capable of donating a hydron to an acceptor (Brønsted base). Bronsted acid A molecular entity capable of donating a hydron to an acceptor (Brønsted base). |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| cyclotriphosphoric acid (CHEBI:16517) is a cyclic phosphorus acid anhydride (CHEBI:37798) |
| cyclotriphosphoric acid (CHEBI:16517) is a inorganic heterocyclic compound (CHEBI:33596) |
| cyclotriphosphoric acid (CHEBI:16517) is a phosphorus oxoacid (CHEBI:33457) |
| cyclotriphosphoric acid (CHEBI:16517) is conjugate acid of cyclotriphosphate(3−) (CHEBI:57801) |
| Incoming Relation(s) |
| cyclotriphosphate(3−) (CHEBI:57801) is conjugate base of cyclotriphosphoric acid (CHEBI:16517) |
| IUPAC Names |
|---|
| tri-μ-oxido-tris(hydroxidooxidophosphorus) |
| 2,4,6-trihydroxido-2,4,6-trioxido-1,3,5-trioxy-2,4,6-triphosphy-[6]cycle |
| 1,3,5,2,4,6-trioxatriphosphinane-2,4,6-triol 2,4,6-trioxide |
| Synonyms | Source |
|---|---|
| Trimetaphosphate | KEGG COMPOUND |
| H3P3O9 | IUPAC |
| cyclo-triphosphoric acid | IUPAC |
| trimetaphosphoric acid | ChemIDplus |
| cyclo-Triphosphoric acid | KEGG COMPOUND |
| Trimetaphosphate | KEGG COMPOUND |
| Manual Xrefs | Databases |
|---|---|
| C02466 | KEGG COMPOUND |
| Registry Numbers | Sources |
|---|---|
| CAS:13566-25-1 | ChemIDplus |