EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C15H12O6 |
| Net Charge | 0 |
| Average Mass | 288.255 |
| Monoisotopic Mass | 288.06339 |
| SMILES | CC1=Cc2oc3cccc(O)c3c(=O)c2[C@@H](C(=O)O)[C@H]1O |
| InChI | InChI=1S/C15H12O6/c1-6-5-9-11(12(13(6)17)15(19)20)14(18)10-7(16)3-2-4-8(10)21-9/h2-5,12-13,16-17H,1H3,(H,19,20)/t12-,13+/m1/s1 |
| InChIKey | PFGOJDXPCPCBJM-OLZOCXBDSA-N |
| Species of Metabolite | Component | Source | Comments |
|---|---|---|---|
| Paecilomyces variotti (ncbitaxon:264951) | - | PubMed (30746079) | Strain: K5103 |
| Roles Classification |
|---|
| Chemical Role: | Bronsted acid A molecular entity capable of donating a hydron to an acceptor (Brønsted base). |
| Biological Role: | fungal metabolite Any eukaryotic metabolite produced during a metabolic reaction in fungi, the kingdom that includes microorganisms such as the yeasts and moulds. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| agnestin A (CHEBI:152052) has role fungal metabolite (CHEBI:76946) |
| agnestin A (CHEBI:152052) is a monocarboxylic acid (CHEBI:25384) |
| agnestin A (CHEBI:152052) is a phenols (CHEBI:33853) |
| agnestin A (CHEBI:152052) is a secondary alcohol (CHEBI:35681) |
| agnestin A (CHEBI:152052) is a xanthones (CHEBI:51149) |
| IUPAC Name |
|---|
| (1R,2R)-2,8-dihydroxy-3-methyl-9-oxo-2,9-dihydro-1H-xanthene-1-carboxylic acid |
| Citations |
|---|