EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C6H12O6 |
| Net Charge | 0 |
| Average Mass | 180.156 |
| Monoisotopic Mass | 180.06339 |
| SMILES | O=C[C@H](O)[C@@H](O)[C@H](O)[C@@H](O)CO |
| WURCS | WURCS=2.0/1,1,0/[o2121h]/1/ |
| InChI | InChI=1S/C6H12O6/c7-1-3(9)5(11)6(12)4(10)2-8/h1,3-6,8-12H,2H2/t3-,4-,5+,6+/m0/s1 |
| InChIKey | GZCGUPFRVQAUEE-UNTFVMJOSA-N |
| Roles Classification |
|---|
| Biological Role: | metabolite Any intermediate or product resulting from metabolism. The term 'metabolite' subsumes the classes commonly known as primary and secondary metabolites. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| aldehydo-L-idose (CHEBI:151298) is a L-idose (CHEBI:86060) |
| aldehydo-L-idose (CHEBI:151298) is enantiomer of aldehydo-D-idose (CHEBI:188986) |
| Incoming Relation(s) |
| aldehydo-D-idose (CHEBI:188986) is enantiomer of aldehydo-L-idose (CHEBI:151298) |
| Manual Xrefs | Databases |
|---|---|
| G55420MQ | GlyTouCan |