EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C6H12N2 |
| Net Charge | 0 |
| Average Mass | 112.176 |
| Monoisotopic Mass | 112.10005 |
| SMILES | C1CN2CCN1CC2 |
| InChI | InChI=1S/C6H12N2/c1-2-8-5-3-7(1)4-6-8/h1-6H2 |
| InChIKey | IMNIMPAHZVJRPE-UHFFFAOYSA-N |
| Wikipedia |
|---|
| Species of Metabolite | Component | Source | Comments |
|---|---|---|---|
| Escherichia coli (ncbitaxon:562) | cell lysate (BTO:0004304) | MetaboLights (MTBLS1079) | Strain: Escherichia coli str. K-12 substr. DH10B [NCBITAXON:316385] |
| Roles Classification |
|---|
| Chemical Roles: | antioxidant A substance that opposes oxidation or inhibits reactions brought about by dioxygen or peroxides. catalyst A substance that increases the rate of a reaction without modifying the overall standard Gibbs energy change in the reaction. Bronsted base A molecular entity capable of accepting a hydron from a donor (Brønsted acid). |
| Application: | reagent A substance used in a chemical reaction to detect, measure, examine, or produce other substances. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| triethylenediamine (CHEBI:151129) has role antioxidant (CHEBI:22586) |
| triethylenediamine (CHEBI:151129) has role catalyst (CHEBI:35223) |
| triethylenediamine (CHEBI:151129) has role reagent (CHEBI:33893) |
| triethylenediamine (CHEBI:151129) is a bridged compound (CHEBI:35990) |
| triethylenediamine (CHEBI:151129) is a diamine (CHEBI:23666) |
| triethylenediamine (CHEBI:151129) is a saturated organic heterobicyclic parent (CHEBI:38419) |
| triethylenediamine (CHEBI:151129) is a tertiary amino compound (CHEBI:50996) |
| IUPAC Name |
|---|
| 1,4-diazabicyclo[2.2.2]octane |
| Synonyms | Source |
|---|---|
| N,N'-endo-ethylenepiperazine | ChemIDplus |
| 1,4-diazabicyclooctane | ChemIDplus |
| 1,4-diazabicyclo-octane | ChemIDplus |
| 1,4-ethylenepiperazine | ChemIDplus |
| 1,4-diaza[2.2.2]bicyclooctane | NIST Chemistry WebBook |
| Brand Names | Source |
|---|---|
| TED | ChemIDplus |
| DABCO | ChemIDplus |
| TEDA | ChemIDplus |
| Citations |
|---|