EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C18H26N2O4 |
| Net Charge | 0 |
| Average Mass | 334.416 |
| Monoisotopic Mass | 334.18926 |
| SMILES | CC(=O)OC1CC(C)(C)N(OC(=O)c2ccc(N)cc2)C(C)(C)C1 |
| InChI | InChI=1S/C18H26N2O4/c1-12(21)23-15-10-17(2,3)20(18(4,5)11-15)24-16(22)13-6-8-14(19)9-7-13/h6-9,15H,10-11,19H2,1-5H3 |
| InChIKey | BVCXOEIOBRWZCA-UHFFFAOYSA-N |
| Species of Metabolite | Component | Source | Comments |
|---|---|---|---|
| Escherichia coli (ncbitaxon:562) | cell lysate (BTO:0004304) | MetaboLights (MTBLS1079) | Strain: Escherichia coli str. K-12 substr. DH10B [NCBITAXON:316385] |
| Roles Classification |
|---|
| Chemical Roles: | Bronsted base A molecular entity capable of accepting a hydron from a donor (Brønsted acid). Bronsted acid A molecular entity capable of donating a hydron to an acceptor (Brønsted base). |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| Benzoic acid, 4-amino-, 4-acetoxy-2,2,6,6-tetramethyl-1-piperidinyl ester (CHEBI:151072) is a aminobenzoic acid (CHEBI:22495) |
| IUPAC Name |
|---|
| (4-acetyloxy-2,2,6,6-tetramethylpiperidin-1-yl) 4-aminobenzoate |