EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C12H26 |
| Net Charge | 0 |
| Average Mass | 170.340 |
| Monoisotopic Mass | 170.20345 |
| SMILES | CC(C)CCCCCCC(C)C |
| InChI | InChI=1S/C12H26/c1-11(2)9-7-5-6-8-10-12(3)4/h11-12H,5-10H2,1-4H3 |
| InChIKey | HWISDPDDDUZJAW-UHFFFAOYSA-N |
| Species of Metabolite | Component | Source | Comments |
|---|---|---|---|
| Angelica sinensis (ncbitaxon:165353) | root (BTO:0001188) | DOI (10.1007/s11771-005-0177-8) | |
| Cassia javanica (ncbitaxon:508996) | flower (BTO:0000469) | PubMed (31238555) | |
| Escherichia coli (ncbitaxon:562) | cell lysate (BTO:0004304) | MetaboLights (MTBLS1079) | Strain: Escherichia coli str. K-12 substr. DH10B [NCBITAXON:316385] |
| Tecoma stans (ncbitaxon:69904) | flower (BTO:0000469) | PubMed (31238555) | |
| Trichoderma harzianum (ncbitaxon:5544) | cell suspension culture (BTO:0000221) | PubMed (22407347) |
| Roles Classification |
|---|
| Biological Roles: | bacterial metabolite Any prokaryotic metabolite produced during a metabolic reaction in bacteria. volatile oil component Any plant metabolite that is found naturally as a component of a volatile oil. plant metabolite Any eukaryotic metabolite produced during a metabolic reaction in plants, the kingdom that include flowering plants, conifers and other gymnosperms. fungal metabolite Any eukaryotic metabolite produced during a metabolic reaction in fungi, the kingdom that includes microorganisms such as the yeasts and moulds. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| 2,9-dimethyldecane (CHEBI:151058) has role bacterial metabolite (CHEBI:76969) |
| 2,9-dimethyldecane (CHEBI:151058) has role fungal metabolite (CHEBI:76946) |
| 2,9-dimethyldecane (CHEBI:151058) has role plant metabolite (CHEBI:76924) |
| 2,9-dimethyldecane (CHEBI:151058) has role volatile oil component (CHEBI:27311) |
| 2,9-dimethyldecane (CHEBI:151058) is a alkane (CHEBI:18310) |
| 2,9-dimethyldecane (CHEBI:151058) is a volatile organic compound (CHEBI:134179) |
| IUPAC Name |
|---|
| 2,9-dimethyldecane |
| Synonyms | Source |
|---|---|
| 2,9-Dimethyldecan | ChEBI |
| 2,9-dimethyl-decane | ChEBI |
| 2,9-diméthyldécane | ChEBI |
| Citations |
|---|