EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C16H24Cl2N2 |
| Net Charge | 0 |
| Average Mass | 315.288 |
| Monoisotopic Mass | 314.13165 |
| SMILES | CN(CCc1ccc(Cl)c(Cl)c1)C[C@H]1CCCCN1C |
| InChI | InChI=1S/C16H24Cl2N2/c1-19(12-14-5-3-4-9-20(14)2)10-8-13-6-7-15(17)16(18)11-13/h6-7,11,14H,3-5,8-10,12H2,1-2H3/t14-/m1/s1 |
| InChIKey | BBURUCNUCKNLNA-CQSZACIVSA-N |
| Species of Metabolite | Component | Source | Comments |
|---|---|---|---|
| Escherichia coli (ncbitaxon:562) | cell lysate (BTO:0004304) | MetaboLights (MTBLS1079) | Strain: Escherichia coli str. K-12 substr. DH10B [NCBITAXON:316385] |
| Roles Classification |
|---|
| Chemical Role: | Bronsted base A molecular entity capable of accepting a hydron from a donor (Brønsted acid). |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| 2-Azabutane, 1-[1-methylazacyclohex-2-yl]-2-methyl-4-[3,4-dichlorophenyl]- (CHEBI:151039) is a primary amine (CHEBI:32877) |
| IUPAC Name |
|---|
| 2-(3,4-dichlorophenyl)-N-methyl-N-[(1-methylpiperidin-2-yl)methyl]ethanamine |