EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C6H8O7 |
| Net Charge | 0 |
| Average Mass | 192.123 |
| Monoisotopic Mass | 192.02700 |
| SMILES | O=C(O)C[C@H](C(=O)O)[C@@H](O)C(=O)O |
| InChI | InChI=1S/C6H8O7/c7-3(8)1-2(5(10)11)4(9)6(12)13/h2,4,9H,1H2,(H,7,8)(H,10,11)(H,12,13)/t2-,4+/m0/s1 |
| InChIKey | ODBLHEXUDAPZAU-ZAFYKAAXSA-N |
| Roles Classification |
|---|
| Chemical Roles: | Bronsted acid A molecular entity capable of donating a hydron to an acceptor (Brønsted base). Bronsted acid A molecular entity capable of donating a hydron to an acceptor (Brønsted base). |
| Biological Role: | fundamental metabolite Any metabolite produced by all living cells. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| D-threo-isocitric acid (CHEBI:151) is a isocitric acid (CHEBI:30887) |
| D-threo-isocitric acid (CHEBI:151) is conjugate acid of D-threo-isocitrate(3−) (CHEBI:15562) |
| D-threo-isocitric acid (CHEBI:151) is enantiomer of L-threo-isocitric acid (CHEBI:30889) |
| Incoming Relation(s) |
| D-threo-isocitrate(3−) (CHEBI:15562) is conjugate base of D-threo-isocitric acid (CHEBI:151) |
| L-threo-isocitric acid (CHEBI:30889) is enantiomer of D-threo-isocitric acid (CHEBI:151) |
| IUPAC Names |
|---|
| (1R,2S)-1-hydroxypropane-1,2,3-tricarboxylic acid |
| 3-carboxy-2,3-dideoxy-L-threo-pentaric acid |
| Synonyms | Source |
|---|---|
| D-threo-Isocitric acid | KEGG COMPOUND |
| ISOCITRIC ACID | PDBeChem |
| (+)-threo-isocitric acid | HMDB |
| Manual Xrefs | Databases |
|---|---|
| C00001188 | KNApSAcK |
| C00451 | KEGG COMPOUND |
| HMDB0001874 | HMDB |
| ICT | PDBeChem |
| THREO-DS-ISO-CITRATE | MetaCyc |
| Registry Numbers | Sources |
|---|---|
| Gmelin:1220309 | Gmelin |
| Reaxys:1727947 | Reaxys |
| CAS:6061-97-8 | KEGG COMPOUND |
| Citations |
|---|