EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C17H12Cl2O7 |
| Net Charge | 0 |
| Average Mass | 399.182 |
| Monoisotopic Mass | 397.99601 |
| SMILES | COC(=O)C1=CC(=O)C=C(OC)[C@]12Oc1c(Cl)c(C)c(Cl)c(O)c1C2=O |
| InChI | InChI=1S/C17H12Cl2O7/c1-6-11(18)13(21)10-14(12(6)19)26-17(15(10)22)8(16(23)25-3)4-7(20)5-9(17)24-2/h4-5,21H,1-3H3/t17-/m1/s1 |
| InChIKey | LUBKKVGXMXTXOZ-QGZVFWFLSA-N |
| Species of Metabolite | Component | Source | Comments |
|---|---|---|---|
| Aspergillus terreus (ncbitaxon:33178) | cell suspension culture (BTO:0000221) | PubMed (21368412) | Strain: IBT 28226 |
| Aspergillus terreus ATCC 20542 (ncbitaxon:285217) | cell suspension culture (BTO:0000221) | PubMed (17689800) | |
| Penicillium glabrum (ncbitaxon:69773) | cell suspension culture (BTO:0000221) | PubMed (16320762) | Strain: AJ117540 |
| Roles Classification |
|---|
| Biological Roles: | Aspergillus metabolite Any fungal metabolite produced during a metabolic reaction in the mould, Aspergillus . Penicillium metabolite Any fungal metabolite produced during a metabolic reaction in Penicillium. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| (+)-geodin (CHEBI:150867) has role Aspergillus metabolite (CHEBI:76956) |
| (+)-geodin (CHEBI:150867) has role Penicillium metabolite (CHEBI:76964) |
| (+)-geodin (CHEBI:150867) is a 1-benzofurans (CHEBI:38830) |
| (+)-geodin (CHEBI:150867) is a ether (CHEBI:25698) |
| (+)-geodin (CHEBI:150867) is a methyl ester (CHEBI:25248) |
| (+)-geodin (CHEBI:150867) is a organochlorine compound (CHEBI:36683) |
| (+)-geodin (CHEBI:150867) is a oxaspiro compound (CHEBI:37948) |
| (+)-geodin (CHEBI:150867) is a phenols (CHEBI:33853) |
| (+)-geodin (CHEBI:150867) is conjugate acid of (+)-geodin(1−) (CHEBI:150868) |
| Incoming Relation(s) |
| (+)-geodin(1−) (CHEBI:150868) is conjugate base of (+)-geodin (CHEBI:150867) |
| IUPAC Name |
|---|
| methyl (1'R)-5,7-dichloro-4-hydroxy-6'-methoxy-6-methyl-3,4'-dioxo-3H-spiro[[1]benzofuran-2,1'-cyclohexa[2,5]diene]-2'-carboxylate |
| Synonyms | Source |
|---|---|
| (2R)-methyl-5,7-dichloro-4-hydroxy-6'-methoxy-6-methyl-3,4'-dioxospiro-[benzofuran-2,1'-cyclohexa-2',5'-diene]-2'-carboxylate | SUBMITTER |
| erdin (+)-form methyl ester | ChemIDplus |
| (+)-erdin methyl ester | ChEBI |
| estin | ChemIDplus |
| geodin | ChemIDplus |
| D-geodin | ChemIDplus |
| Citations |
|---|