EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C12H16O4 |
| Net Charge | 0 |
| Average Mass | 224.256 |
| Monoisotopic Mass | 224.10486 |
| SMILES | CCCCCC(=O)c1c(O)cc(O)cc1O |
| InChI | InChI=1S/C12H16O4/c1-2-3-4-5-9(14)12-10(15)6-8(13)7-11(12)16/h6-7,13,15-16H,2-5H2,1H3 |
| InChIKey | RGMMTOZHCJCZRW-UHFFFAOYSA-N |
| Species of Metabolite | Component | Source | Comments |
|---|---|---|---|
| Syncarpia glomulifera (ncbitaxon:178137) | bark (BTO:0001301) | PubMed (27112454) | Isolated from stem bark. |
| Roles Classification |
|---|
| Biological Role: | plant metabolite Any eukaryotic metabolite produced during a metabolic reaction in plants, the kingdom that include flowering plants, conifers and other gymnosperms. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| 2,4,6-trihydroxyphenylhexan-1-one (CHEBI:150865) has role plant metabolite (CHEBI:76924) |
| 2,4,6-trihydroxyphenylhexan-1-one (CHEBI:150865) is a 2-acylphloroglucinol (CHEBI:134316) |
| IUPAC Name |
|---|
| 1-(2,4,6-trihydroxyphenyl)hexan-1-one |
| Synonyms | Source |
|---|---|
| 1-(2,4,6-trihydroxyphenyl)-1-hexanone | ChEBI |
| 2-hexanoyl-1,3,5-benzenetriol | ChEBI |
| hexanoyl phloroglucinol | ChEBI |
| phlorocaprophenone | ChEBI |
| THPH | ChEBI |
| UniProt Name | Source |
|---|---|
| 2,4,6-trihydroxyphenylhexan-1-one | UniProt |
| Registry Numbers | Sources |
|---|---|
| CAS:5665-89-4 | ChEBI |
| Citations |
|---|