EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C13H15NO3 |
| Net Charge | 0 |
| Average Mass | 233.267 |
| Monoisotopic Mass | 233.10519 |
| SMILES | CC1(C)C(=O)C(=O)NC1Cc1ccc(O)cc1 |
| InChI | InChI=1S/C13H15NO3/c1-13(2)10(14-12(17)11(13)16)7-8-3-5-9(15)6-4-8/h3-6,10,15H,7H2,1-2H3,(H,14,17) |
| InChIKey | MNKCCFOQDGJSLR-UHFFFAOYSA-N |
| Roles Classification |
|---|
| Biological Roles: | cofactor An organic molecule or ion (usually a metal ion) that is required by an enzyme for its activity. It may be attached either loosely (coenzyme) or tightly (prosthetic group). bacterial metabolite Any prokaryotic metabolite produced during a metabolic reaction in bacteria. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| premycofactocin (CHEBI:150862) has role bacterial metabolite (CHEBI:76969) |
| premycofactocin (CHEBI:150862) has role cofactor (CHEBI:23357) |
| premycofactocin (CHEBI:150862) is a phenols (CHEBI:33853) |
| premycofactocin (CHEBI:150862) is a pyrrolidin-2-ones (CHEBI:74223) |
| Incoming Relation(s) |
| premycofactocinol (CHEBI:156521) has functional parent premycofactocin (CHEBI:150862) |
| IUPAC Name |
|---|
| 5-(4-hydroxybenzyl)-4,4-dimethylpyrrolidine-2,3-dione |
| Synonyms | Source |
|---|---|
| 5-[(4-hydroxyphenyl)methyl]-4,4-dimethylpyrrolidine-2,3-dione | IUPAC |
| premycofactocin | ChEBI |
| UniProt Name | Source |
|---|---|
| pre-mycofactocin | UniProt |
| Manual Xrefs | Databases |
|---|---|
| CPD-22872 | MetaCyc |
| Citations |
|---|