EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C11H18O11 |
| Net Charge | 0 |
| Average Mass | 326.254 |
| Monoisotopic Mass | 326.08491 |
| SMILES | O=C(O)[C@H]1O[C@@H](O[C@@H]2CO[C@@H](O)[C@H](O)[C@H]2O)[C@H](O)[C@@H](O)[C@@H]1O |
| WURCS | WURCS=2.0/2,2,1/[a212h-1b_1-5][a2122A-1b_1-5]/1-2/a4-b1 |
| InChI | InChI=1S/C11H18O11/c12-3-2(1-20-10(19)6(3)15)21-11-7(16)4(13)5(14)8(22-11)9(17)18/h2-8,10-16,19H,1H2,(H,17,18)/t2-,3+,4+,5+,6-,7-,8+,10-,11-/m1/s1 |
| InChIKey | GGIZFHSZEPFEJR-GKBAEXNQSA-N |
| Roles Classification |
|---|
| Chemical Role: | Bronsted acid A molecular entity capable of donating a hydron to an acceptor (Brønsted base). |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| β-D-GlcpA-(1→4)-β-D-Xylp (CHEBI:150680) is a glucosiduronic acid (CHEBI:24302) |
| β-D-GlcpA-(1→4)-β-D-Xylp (CHEBI:150680) is a glycosylxylose (CHEBI:35380) |
| β-D-GlcpA-(1→4)-β-D-Xylp (CHEBI:150680) is a monocarboxylic acid (CHEBI:25384) |
| IUPAC Names |
|---|
| 4-O-β-D-glucopyranuronosyl-β-D-xylopyranose |
| GlcA(b1-4)b-Xyl |
| Synonyms | Source |
|---|---|
| (2S,3S,4S,5R,6R)-3,4,5-trihydroxy-6-[(3R,4R,5R,6R)-4,5,6-trihydroxyoxan-3-yl]oxyoxane-2-carboxylic acid | IUPAC |
| β-D-gluco-hexopyranosyluronic acid-(1→4)-β-D-xylo-pentopyranose | IUPAC |