EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C15H12O4 |
| Net Charge | 0 |
| Average Mass | 256.257 |
| Monoisotopic Mass | 256.07356 |
| SMILES | Cc1cc(O)c2c(c1)Cc1cc(O)cc(O)c1C2=O |
| InChI | InChI=1S/C15H12O4/c1-7-2-8-4-9-5-10(16)6-12(18)14(9)15(19)13(8)11(17)3-7/h2-3,5-6,16-18H,4H2,1H3 |
| InChIKey | LAJSXCAVRQXZIO-UHFFFAOYSA-N |
| Roles Classification |
|---|
| Biological Role: | fungal metabolite Any eukaryotic metabolite produced during a metabolic reaction in fungi, the kingdom that includes microorganisms such as the yeasts and moulds. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| emodin anthrone (CHEBI:150013) has role fungal metabolite (CHEBI:76946) |
| emodin anthrone (CHEBI:150013) is a anthracenone (CHEBI:146281) |
| emodin anthrone (CHEBI:150013) is a phenols (CHEBI:33853) |
| Incoming Relation(s) |
| emodin (CHEBI:42223) has functional parent emodin anthrone (CHEBI:150013) |
| IUPAC Name |
|---|
| 1,3,8-trihydroxy-6-methylanthracen-9(10H)-one |
| Synonyms | Source |
|---|---|
| 1,3,8-trihydroxy-6-methylanthrone | ChemIDplus |
| emodin-9-anthrone | SUBMITTER |
| emodinanthrone | ChemIDplus |
| UniProt Name | Source |
|---|---|
| emodin anthrone | UniProt |
| Manual Xrefs | Databases |
|---|---|
| C00000569 | KNApSAcK |
| FDB015346 | FooDB |
| HMDB0036457 | HMDB |
| RXN-14896 | MetaCyc |
| Registry Numbers | Sources |
|---|---|
| CAS:491-60-1 | ChemIDplus |
| Citations |
|---|