EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C10H20O7P2 |
| Net Charge | 0 |
| Average Mass | 314.211 |
| Monoisotopic Mass | 314.06843 |
| SMILES | CC1(C)[C@@H]2CC[C@@]1(C)[C@@H](OP(=O)(O)OP(=O)(O)O)C2 |
| InChI | InChI=1S/C10H20O7P2/c1-9(2)7-4-5-10(9,3)8(6-7)16-19(14,15)17-18(11,12)13/h7-8H,4-6H2,1-3H3,(H,14,15)(H2,11,12,13)/t7-,8+,10+/m1/s1 |
| InChIKey | VZPAJODTZAAANV-WEDXCCLWSA-N |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| (+)-bornyl diphosphate (CHEBI:15395) has functional parent (+)-borneol (CHEBI:15393) |
| (+)-bornyl diphosphate (CHEBI:15395) is a bornane monoterpenoid (CHEBI:22912) |
| (+)-bornyl diphosphate (CHEBI:15395) is a monoterpenyl phosphate (CHEBI:25412) |
| (+)-bornyl diphosphate (CHEBI:15395) is conjugate acid of (+)-bornyl diphosphate(3−) (CHEBI:57293) |
| (+)-bornyl diphosphate (CHEBI:15395) is enantiomer of (−)-bornyl diphosphate (CHEBI:64298) |
| Incoming Relation(s) |
| (+)-bornyl diphosphate(3−) (CHEBI:57293) is conjugate base of (+)-bornyl diphosphate (CHEBI:15395) |
| (−)-bornyl diphosphate (CHEBI:64298) is enantiomer of (+)-bornyl diphosphate (CHEBI:15395) |
| IUPAC Name |
|---|
| (1R,2S,4R)-1,7,7-trimethylbicyclo[2.2.1]hept-2-yl trihydrogen diphosphate |
| Synonyms | Source |
|---|---|
| (+)-Bornyl diphosphate | KEGG COMPOUND |
| (+)-Bornyl-diphosphate | KEGG COMPOUND |
| Manual Xrefs | Databases |
|---|---|
| BP2 | PDBeChem |
| C03190 | KEGG COMPOUND |
| C03190 | KEGG COMPOUND |
| LMPR0102120009 | LIPID MAPS |
| Citations |
|---|