EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C5H8O6 |
| Net Charge | 0 |
| Average Mass | 164.113 |
| Monoisotopic Mass | 164.03209 |
| SMILES | [H]C(=O)[C@H](O)[C@@H](O)[C@@H](O)C(=O)O |
| WURCS | WURCS=2.0/1,1,0/[o211A]/1/ |
| InChI | InChI=1S/C5H8O6/c6-1-2(7)3(8)4(9)5(10)11/h1-4,7-9H,(H,10,11)/t2-,3+,4+/m0/s1 |
| InChIKey | VQUZNVATTCZTQO-PZGQECOJSA-N |
| Roles Classification |
|---|
| Chemical Role: | Bronsted acid A molecular entity capable of donating a hydron to an acceptor (Brønsted base). |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| L-arabinuronic acid (CHEBI:149999) is a arabinuronic acid (CHEBI:150000) |
| L-arabinuronic acid (CHEBI:149999) is conjugate acid of L-arabinuronate (CHEBI:149672) |
| L-arabinuronic acid (CHEBI:149999) is enantiomer of D-arabinuronic acid (CHEBI:150001) |
| Incoming Relation(s) |
| L-arabinuronate (CHEBI:149672) is conjugate base of L-arabinuronic acid (CHEBI:149999) |
| D-arabinuronic acid (CHEBI:150001) is enantiomer of L-arabinuronic acid (CHEBI:149999) |
| IUPAC Name |
|---|
| L-arabinuronic acid |
| Synonym | Source |
|---|---|
| (2R,3R,4R)-2,3,4-trihydroxy-5-oxopentanoic acid | IUPAC |
| Citations |
|---|