EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C22H15ClO7 |
| Net Charge | 0 |
| Average Mass | 426.808 |
| Monoisotopic Mass | 426.05063 |
| SMILES | O=c1c(O)c(-c2ccc(O)c(O)c2)oc2cc(OCc3ccc(Cl)cc3)cc(O)c12 |
| InChI | InChI=1S/C22H15ClO7/c23-13-4-1-11(2-5-13)10-29-14-8-17(26)19-18(9-14)30-22(21(28)20(19)27)12-3-6-15(24)16(25)7-12/h1-9,24-26,28H,10H2 |
| InChIKey | BYQBMIHQROWCQG-UHFFFAOYSA-N |
| Roles Classification |
|---|
| Biological Role: | anticoronaviral agent Any antiviral agent which inhibits the activity of coronaviruses. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| 7-(4-Chloro-benzyloxy)-2-(3,4-dihydroxy-phenyl)-3,5-dihydroxy-chromen-4-one (CHEBI:149990) has role anticoronaviral agent (CHEBI:149553) |
| 7-(4-Chloro-benzyloxy)-2-(3,4-dihydroxy-phenyl)-3,5-dihydroxy-chromen-4-one (CHEBI:149990) is a hydroxyflavan (CHEBI:72010) |