EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C16H14Cl2N2OS |
| Net Charge | 0 |
| Average Mass | 353.274 |
| Monoisotopic Mass | 352.02039 |
| SMILES | CC1SC(c2c(Cl)cccc2Cl)N(Cc2cccnc2)C1=O |
| InChI | InChI=1S/C16H14Cl2N2OS/c1-10-15(21)20(9-11-4-3-7-19-8-11)16(22-10)14-12(17)5-2-6-13(14)18/h2-8,10,16H,9H2,1H3 |
| InChIKey | LKXQTLAWFJJCNQ-UHFFFAOYSA-N |
| Roles Classification |
|---|
| Biological Role: | anticoronaviral agent Any antiviral agent which inhibits the activity of coronaviruses. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| 2-(2,6-Dichlorophenyl)-5-methyl-3-(3-pyridylmethyl)thiazolidin-4-one (CHEBI:149985) has role anticoronaviral agent (CHEBI:149553) |
| 2-(2,6-Dichlorophenyl)-5-methyl-3-(3-pyridylmethyl)thiazolidin-4-one (CHEBI:149985) is a dichlorobenzene (CHEBI:23697) |